EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9O4 |
| Net Charge | -1 |
| Average Mass | 145.134 |
| Monoisotopic Mass | 145.05063 |
| SMILES | CCC(O)CC(=O)C(=O)[O-] |
| InChI | InChI=1S/C6H10O4/c1-2-4(7)3-5(8)6(9)10/h4,7H,2-3H2,1H3,(H,9,10)/p-1 |
| InChIKey | ALFQPWXBAWHVDP-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-2-oxohexanoate (CHEBI:53800) has functional parent hexanoate (CHEBI:17120) |
| 4-hydroxy-2-oxohexanoate (CHEBI:53800) is a 2-oxo monocarboxylic acid anion (CHEBI:35179) |
| 4-hydroxy-2-oxohexanoate (CHEBI:53800) is a hydroxy fatty acid anion (CHEBI:59835) |
| 4-hydroxy-2-oxohexanoate (CHEBI:53800) is a medium-chain fatty acid anion (CHEBI:59558) |
| 4-hydroxy-2-oxohexanoate (CHEBI:53800) is a oxo fatty acid anion (CHEBI:59836) |
| 4-hydroxy-2-oxohexanoate (CHEBI:53800) is a straight-chain saturated fatty acid anion (CHEBI:58954) |
| 4-hydroxy-2-oxohexanoate (CHEBI:53800) is conjugate base of 4-hydroxy-2-oxohexanoic acid (CHEBI:27530) |
| Incoming Relation(s) |
| (S)-4-hydroxy-2-oxohexanoate (CHEBI:73142) is a 4-hydroxy-2-oxohexanoate (CHEBI:53800) |
| 4-hydroxy-2-oxohexanoic acid (CHEBI:27530) is conjugate acid of 4-hydroxy-2-oxohexanoate (CHEBI:53800) |
| IUPAC Name |
|---|
| 4-hydroxy-2-oxohexanoate |
| UniProt Name | Source |
|---|---|
| 4-hydroxy-2-oxohexanoate | UniProt |