EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N5O5 |
| Net Charge | 0 |
| Average Mass | 283.244 |
| Monoisotopic Mass | 283.09167 |
| SMILES | Nc1nc(=O)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@@H]3O)c2n1 |
| InChI | InChI=1S/C10H13N5O5/c11-10-13-7-4(8(19)14-10)12-2-15(7)9-6(18)5(17)3(1-16)20-9/h2-3,5-6,9,16-18H,1H2,(H3,11,13,14,19)/t3-,5-,6+,9-/m1/s1 |
| InChIKey | NYHBQMYGNKIUIF-FJFJXFQQSA-N |
| Roles Classification |
|---|
| Biological Role: | DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-β-D-arabinofuranosylguanine (CHEBI:73141) has role antineoplastic agent (CHEBI:35610) |
| 9-β-D-arabinofuranosylguanine (CHEBI:73141) has role DNA synthesis inhibitor (CHEBI:59517) |
| 9-β-D-arabinofuranosylguanine (CHEBI:73141) is a purine nucleoside (CHEBI:26394) |
| 9-β-D-arabinofuranosylguanine (CHEBI:73141) is a β-D-arabinoside (CHEBI:38315) |
| Incoming Relation(s) |
| nelarabine (CHEBI:63612) has functional parent 9-β-D-arabinofuranosylguanine (CHEBI:73141) |
| IUPAC Name |
|---|
| 2-amino-9-(β-D-arabinofuranosyl)-1,9-dihydro-6H-purin-6-one |
| Synonyms | Source |
|---|---|
| 9-arabinofuranosylguanine | ChemIDplus |
| 9-(β-D-arabinofuranosyl)guanine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:38819-10-2 | ChemIDplus |
| Citations |
|---|