EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15N5O5 |
| Net Charge | 0 |
| Average Mass | 297.271 |
| Monoisotopic Mass | 297.10732 |
| SMILES | COc1nc(N)nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H15N5O5/c1-20-9-5-8(14-11(12)15-9)16(3-13-5)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2,12,14,15)/t4-,6-,7+,10-/m1/s1 |
| InChIKey | IXOXBSCIXZEQEQ-UHTZMRCNSA-N |
| Roles Classification |
|---|
| Biological Role: | DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nelarabine (CHEBI:63612) has functional parent 9-β-D-arabinofuranosylguanine (CHEBI:73141) |
| nelarabine (CHEBI:63612) has functional parent guanine (CHEBI:16235) |
| nelarabine (CHEBI:63612) has role antineoplastic agent (CHEBI:35610) |
| nelarabine (CHEBI:63612) has role DNA synthesis inhibitor (CHEBI:59517) |
| nelarabine (CHEBI:63612) has role prodrug (CHEBI:50266) |
| nelarabine (CHEBI:63612) is a monosaccharide derivative (CHEBI:63367) |
| nelarabine (CHEBI:63612) is a purine nucleoside (CHEBI:26394) |
| nelarabine (CHEBI:63612) is a β-D-arabinoside (CHEBI:38315) |
| IUPAC Name |
|---|
| 9-(β-D-arabinofuranosyl)-6-methoxy-9H-purin-2-amine |
| INN | Source |
|---|---|
| nelzarabine | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 2-Amino-9-beta-D-arabinofuranosyl-6-methoxy-9H-purine | ChemIDplus |
| Nelzarabine | KEGG DRUG |
| Brand Name | Source |
|---|---|
| Arranon | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13568768 | Reaxys |
| CAS:121032-29-9 | ChemIDplus |
| CAS:121032-29-9 | KEGG DRUG |
| Citations |
|---|