EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17NO2S |
| Net Charge | 0 |
| Average Mass | 323.417 |
| Monoisotopic Mass | 323.09800 |
| SMILES | CC1(C)CCSc2ccc(C#Cc3ccc(C(=O)O)cn3)cc21 |
| InChI | InChI=1S/C19H17NO2S/c1-19(2)9-10-23-17-8-4-13(11-16(17)19)3-6-15-7-5-14(12-20-15)18(21)22/h4-5,7-8,11-12H,9-10H2,1-2H3,(H,21,22) |
| InChIKey | IQIBKLWBVJPOQO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. |
| Application: | keratolytic drug A drug that softens, separates, and causes desquamation of the cornified epithelium or horny layer of skin. Keratolytic drugs are used to expose mycelia of infecting fungi or to treat corns, warts, and certain other skin diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tazarotenic acid (CHEBI:73129) has role keratolytic drug (CHEBI:50176) |
| tazarotenic acid (CHEBI:73129) has role teratogenic agent (CHEBI:50905) |
| tazarotenic acid (CHEBI:73129) is a monocarboxylic acid (CHEBI:25384) |
| tazarotenic acid (CHEBI:73129) is a pyridines (CHEBI:26421) |
| tazarotenic acid (CHEBI:73129) is a retinoid (CHEBI:26537) |
| tazarotenic acid (CHEBI:73129) is a thiochromane (CHEBI:50747) |
| Incoming Relation(s) |
| tazarotene (CHEBI:32184) has functional parent tazarotenic acid (CHEBI:73129) |
| IUPAC Name |
|---|
| 6-[(4,4-dimethyl-3,4-dihydro-2H-1-benzothiopyran-6-yl)ethynyl]nicotinic acid |
| Synonyms | Source |
|---|---|
| 6-(2-(4,4-dimethylthiochroman-6-yl)ethynyl)nicotinic acid | ChemIDplus |
| 6-((3,4-dihydro-4,4-dimethyl-2H-1-benzothiopyran-6-yl)ethynyl)-3-pyridinecarboxylic acid | ChemIDplus |
| Agn 190299 | ChemIDplus |
| AGN 190299 | ChemIDplus |
| AGN-190299 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| US2006020037 | Patent |
| WO2006022964 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9718318 | Reaxys |
| CAS:118292-41-4 | ChemIDplus |
| Citations |
|---|