EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21NO2S |
| Net Charge | 0 |
| Average Mass | 351.471 |
| Monoisotopic Mass | 351.12930 |
| SMILES | CCOC(=O)c1ccc(C#Cc2ccc3c(c2)C(C)(C)CCS3)nc1 |
| InChI | InChI=1S/C21H21NO2S/c1-4-24-20(23)16-7-9-17(22-14-16)8-5-15-6-10-19-18(13-15)21(2,3)11-12-25-19/h6-7,9-10,13-14H,4,11-12H2,1-3H3 |
| InChIKey | OGQICQVSFDPSEI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. keratolytic drug A drug that softens, separates, and causes desquamation of the cornified epithelium or horny layer of skin. Keratolytic drugs are used to expose mycelia of infecting fungi or to treat corns, warts, and certain other skin diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tazarotene (CHEBI:32184) has functional parent tazarotenic acid (CHEBI:73129) |
| tazarotene (CHEBI:32184) has role keratolytic drug (CHEBI:50176) |
| tazarotene (CHEBI:32184) has role prodrug (CHEBI:50266) |
| tazarotene (CHEBI:32184) has role teratogenic agent (CHEBI:50905) |
| tazarotene (CHEBI:32184) is a acetylenic compound (CHEBI:73474) |
| tazarotene (CHEBI:32184) is a ethyl ester (CHEBI:23990) |
| tazarotene (CHEBI:32184) is a pyridines (CHEBI:26421) |
| tazarotene (CHEBI:32184) is a retinoid (CHEBI:26537) |
| tazarotene (CHEBI:32184) is a thiochromane (CHEBI:50747) |
| IUPAC Name |
|---|
| ethyl 6-[(4,4-dimethyl-3,4-dihydro-2H-thiochromen-6-yl)ethynyl]nicotinate |
| INNs | Source |
|---|---|
| tazarotene | ChemIDplus |
| tazarotène | ChEBI |
| tazaroteno | ChEBI |
| tazarotenum | ChEBI |
| Brand Names | Source |
|---|---|
| Tazorac | DrugBank |
| Zorac | DrugBank |
| Avage | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C12531 | KEGG COMPOUND |
| D01132 | KEGG DRUG |
| DB00799 | DrugBank |
| EP284288 | Patent |
| US5089509 | Patent |
| Tazarotene | Wikipedia |
| HMDB0014937 | HMDB |
| 2571 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8159145 | Beilstein |
| CAS:118292-40-3 | ChemIDplus |