EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O4 |
| Net Charge | 0 |
| Average Mass | 332.440 |
| Monoisotopic Mass | 332.19876 |
| SMILES | [H][C@@]12C[C@@H](O)C3=C(C(=O)C(O)=C(C(C)C)C3=O)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C20H28O4/c1-10(2)13-16(22)14-11(21)9-12-19(3,4)7-6-8-20(12,5)15(14)18(24)17(13)23/h10-12,21,23H,6-9H2,1-5H3/t11-,12+,20+/m1/s1 |
| InChIKey | YVSUCPNWDPTGKM-JGRMJRGVSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| horminone (CHEBI:73128) has role antibacterial agent (CHEBI:33282) |
| horminone (CHEBI:73128) has role antineoplastic agent (CHEBI:35610) |
| horminone (CHEBI:73128) has role metabolite (CHEBI:25212) |
| horminone (CHEBI:73128) is a p-quinones (CHEBI:25830) |
| horminone (CHEBI:73128) is a abietane diterpenoid (CHEBI:36762) |
| horminone (CHEBI:73128) is a hydroxyquinone (CHEBI:132130) |
| horminone (CHEBI:73128) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| 12-methyl-5-dehydrohorminone (CHEBI:66364) has functional parent horminone (CHEBI:73128) |
| IUPAC Name |
|---|
| (7α)-7,12-dihydroxyabieta-8,12-diene-11,14-dione |
| Synonym | Source |
|---|---|
| 4b,5,6,7,8,8a,9,10-Octahydro-3,10-dihydroxy-4b,8,8-trimethyl-2-(1-methylethyl)-1,4-phenanthrenedione | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2062542 | Reaxys |
| CAS:21887-01-4 | ChemIDplus |
| Citations |
|---|