EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O4 |
| Net Charge | 0 |
| Average Mass | 332.440 |
| Monoisotopic Mass | 332.19876 |
| SMILES | [H][C@@]12C[C@@H](O)C3=C(C(=O)C(O)=C(C(C)C)C3=O)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C20H28O4/c1-10(2)13-16(22)14-11(21)9-12-19(3,4)7-6-8-20(12,5)15(14)18(24)17(13)23/h10-12,21,23H,6-9H2,1-5H3/t11-,12+,20+/m1/s1 |
| InChIKey | YVSUCPNWDPTGKM-JGRMJRGVSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| horminone (CHEBI:73128) has role antibacterial agent (CHEBI:33282) |
| horminone (CHEBI:73128) has role antineoplastic agent (CHEBI:35610) |
| horminone (CHEBI:73128) has role metabolite (CHEBI:25212) |
| horminone (CHEBI:73128) is a p-quinones (CHEBI:25830) |
| horminone (CHEBI:73128) is a abietane diterpenoid (CHEBI:36762) |
| horminone (CHEBI:73128) is a hydroxyquinone (CHEBI:132130) |
| horminone (CHEBI:73128) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| 12-methyl-5-dehydrohorminone (CHEBI:66364) has functional parent horminone (CHEBI:73128) |
| IUPAC Name |
|---|
| (7α)-7,12-dihydroxyabieta-8,12-diene-11,14-dione |
| Synonym | Source |
|---|---|
| 4b,5,6,7,8,8a,9,10-Octahydro-3,10-dihydroxy-4b,8,8-trimethyl-2-(1-methylethyl)-1,4-phenanthrenedione | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2062542 | Reaxys |
| CAS:21887-01-4 | ChemIDplus |
| Citations |
|---|