EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O4 |
| Net Charge | 0 |
| Average Mass | 344.451 |
| Monoisotopic Mass | 344.19876 |
| SMILES | COC1=C(C(C)C)C(=O)C2=C(C1=O)[C@@]1(C)CCCC(C)(C)C1=C[C@H]2O |
| InChI | InChI=1S/C21H28O4/c1-11(2)14-17(23)15-12(22)10-13-20(3,4)8-7-9-21(13,5)16(15)18(24)19(14)25-6/h10-12,22H,7-9H2,1-6H3/t12-,21+/m1/s1 |
| InChIKey | RUONQJYGQKYSSL-GTJPDFRWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salvia multicaulis (IPNI:456747-1) | root (BTO:0001188) | PubMed (9428161) |
| Roles Classification |
|---|
| Biological Roles: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-methyl-5-dehydrohorminone (CHEBI:66364) has functional parent horminone (CHEBI:73128) |
| 12-methyl-5-dehydrohorminone (CHEBI:66364) has role antitubercular agent (CHEBI:33231) |
| 12-methyl-5-dehydrohorminone (CHEBI:66364) has role metabolite (CHEBI:25212) |
| 12-methyl-5-dehydrohorminone (CHEBI:66364) is a p-quinones (CHEBI:25830) |
| 12-methyl-5-dehydrohorminone (CHEBI:66364) is a abietane diterpenoid (CHEBI:36762) |
| 12-methyl-5-dehydrohorminone (CHEBI:66364) is a enol ether (CHEBI:47985) |
| 12-methyl-5-dehydrohorminone (CHEBI:66364) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| 12-methyl-5-dehydroacetylhorminone (CHEBI:66365) has functional parent 12-methyl-5-dehydrohorminone (CHEBI:66364) |
| IUPAC Name |
|---|
| (7α)-7-hydroxy-12-methoxyabieta-5,8,12-triene-11,14-dione |
| Synonym | Source |
|---|---|
| (4bS,10R)-10-hydroxy-3-methoxy-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,10-tetrahydrophenanthrene-1,4-dione | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7885990 | Reaxys |
| Citations |
|---|