EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O4 |
| Net Charge | 0 |
| Average Mass | 344.451 |
| Monoisotopic Mass | 344.19876 |
| SMILES | COC1=C(C(C)C)C(=O)C2=C(C1=O)[C@@]1(C)CCCC(C)(C)C1=C[C@H]2O |
| InChI | InChI=1S/C21H28O4/c1-11(2)14-17(23)15-12(22)10-13-20(3,4)8-7-9-21(13,5)16(15)18(24)19(14)25-6/h10-12,22H,7-9H2,1-6H3/t12-,21+/m1/s1 |
| InChIKey | RUONQJYGQKYSSL-GTJPDFRWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salvia multicaulis (IPNI:456747-1) | root (BTO:0001188) | PubMed (9428161) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-methyl-5-dehydrohorminone (CHEBI:66364) has functional parent horminone (CHEBI:73128) |
| 12-methyl-5-dehydrohorminone (CHEBI:66364) has role antitubercular agent (CHEBI:33231) |
| 12-methyl-5-dehydrohorminone (CHEBI:66364) has role metabolite (CHEBI:25212) |
| 12-methyl-5-dehydrohorminone (CHEBI:66364) is a p-quinones (CHEBI:25830) |
| 12-methyl-5-dehydrohorminone (CHEBI:66364) is a abietane diterpenoid (CHEBI:36762) |
| 12-methyl-5-dehydrohorminone (CHEBI:66364) is a enol ether (CHEBI:47985) |
| 12-methyl-5-dehydrohorminone (CHEBI:66364) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| 12-methyl-5-dehydroacetylhorminone (CHEBI:66365) has functional parent 12-methyl-5-dehydrohorminone (CHEBI:66364) |
| IUPAC Name |
|---|
| (7α)-7-hydroxy-12-methoxyabieta-5,8,12-triene-11,14-dione |
| Synonym | Source |
|---|---|
| (4bS,10R)-10-hydroxy-3-methoxy-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,10-tetrahydrophenanthrene-1,4-dione | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7885990 | Reaxys |
| Citations |
|---|