EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:73083 - (7,8-dihydropterin-6-yl)methyl diphosphate
| Formula | C7H11N5O8P2 |
| Net Charge | 0 |
| Average Mass | 355.140 |
| Monoisotopic Mass | 355.00829 |
| SMILES | Nc1nc2c(c(=O)n1)N=C(COP(=O)(O)OP(=O)(O)O)CN2 |
| InChI | InChI=1S/C7H11N5O8P2/c8-7-11-5-4(6(13)12-7)10-3(1-9-5)2-19-22(17,18)20-21(14,15)16/h1-2H2,(H,17,18)(H2,14,15,16)(H4,8,9,11,12,13) |
| InChIKey | FCQGJGLSOWZZON-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (7,8-dihydropterin-6-yl)methyl diphosphate (CHEBI:73083) has part diphosphate group (CHEBI:68836) |
| (7,8-dihydropterin-6-yl)methyl diphosphate (CHEBI:73083) is a pterin phosphate (CHEBI:36942) |
| (7,8-dihydropterin-6-yl)methyl diphosphate (CHEBI:73083) is a tetrahydropterin (CHEBI:30436) |
| (7,8-dihydropterin-6-yl)methyl diphosphate (CHEBI:73083) is conjugate acid of (7,8-dihydropterin-6-yl)methyl diphosphate(3−) (CHEBI:72950) |
| (7,8-dihydropterin-6-yl)methyl diphosphate (CHEBI:73083) is tautomer of (2-amino-4-hydroxy-7,8-dihydropteridin-6-yl)methyl trihydrogen diphosphate (CHEBI:15998) |
| Incoming Relation(s) |
| (7,8-dihydropterin-6-yl)methyl diphosphate(3−) (CHEBI:72950) is conjugate base of (7,8-dihydropterin-6-yl)methyl diphosphate (CHEBI:73083) |
| (2-amino-4-hydroxy-7,8-dihydropteridin-6-yl)methyl trihydrogen diphosphate (CHEBI:15998) is tautomer of (7,8-dihydropterin-6-yl)methyl diphosphate (CHEBI:73083) |
| IUPAC Name |
|---|
| (2-amino-4-oxo-3,4,7,8-tetrahydropteridin-6-yl)methyl trihydrogen diphosphate |
| Synonyms | Source |
|---|---|
| 2-amino-4-oxo-6-hydroxymethyl-3,4,7,8-tetrahydropterin diphosphate | ChEBI |
| 6-hydroxymethyldihydropterin diphosphate | MetaCyc |
| 7,8-Dihydropterin pyrophosphate | KEGG COMPOUND |
| Diphosphoric acid mono((2-amino-1,4,7,8-tetrahydro-4-oxo-6-pteridinyl)methyl) ester | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2PH | PDBeChem |
| C04807 | KEGG COMPOUND |
| DIHYDROPTERIN-CH2OH-PP | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1187493 | Reaxys |
| CAS:3545-84-4 | ChemIDplus |
| Citations |
|---|