EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8N5O8P2 |
| Net Charge | -3 |
| Average Mass | 352.116 |
| Monoisotopic Mass | 351.98646 |
| SMILES | Nc1nc2c(c(=O)n1)N=C(COP(=O)([O-])OP(=O)([O-])[O-])CN2 |
| InChI | InChI=1S/C7H11N5O8P2/c8-7-11-5-4(6(13)12-7)10-3(1-9-5)2-19-22(17,18)20-21(14,15)16/h1-2H2,(H,17,18)(H2,14,15,16)(H4,8,9,11,12,13)/p-3 |
| InChIKey | FCQGJGLSOWZZON-UHFFFAOYSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (7,8-dihydropterin-6-yl)methyl diphosphate(3−) (CHEBI:72950) is a organophosphate oxoanion (CHEBI:58945) |
| (7,8-dihydropterin-6-yl)methyl diphosphate(3−) (CHEBI:72950) is conjugate base of (7,8-dihydropterin-6-yl)methyl diphosphate (CHEBI:73083) |
| (7,8-dihydropterin-6-yl)methyl diphosphate(3−) (CHEBI:72950) is tautomer of (2-amino-4-hydroxy-7,8-dihydropteridin-6-yl)methyl diphosphate(3−) (CHEBI:57602) |
| Incoming Relation(s) |
| (7,8-dihydropterin-6-yl)methyl diphosphate (CHEBI:73083) is conjugate acid of (7,8-dihydropterin-6-yl)methyl diphosphate(3−) (CHEBI:72950) |
| (2-amino-4-hydroxy-7,8-dihydropteridin-6-yl)methyl diphosphate(3−) (CHEBI:57602) is tautomer of (7,8-dihydropterin-6-yl)methyl diphosphate(3−) (CHEBI:72950) |
| IUPAC Name |
|---|
| (2-amino-4-oxo-3,4,7,8-tetrahydropteridin-6-yl)methyl diphosphate |
| Synonym | Source |
|---|---|
| 6-hydroxymethyldihydropterin diphosphate | MetaCyc |
| UniProt Name | Source |
|---|---|
| (7,8-dihydropterin-6-yl)methyl diphosphate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| DIHYDROPTERIN-CH2OH-PP | MetaCyc |
| Citations |
|---|