EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H35N3O12 |
| Net Charge | 0 |
| Average Mass | 485.487 |
| Monoisotopic Mass | 485.22207 |
| SMILES | N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](N)C[C@@H]2N)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H35N3O12/c19-4-1-5(20)16(33-18-13(28)12(27)10(25)7(3-23)31-18)14(29)15(4)32-17-8(21)11(26)9(24)6(2-22)30-17/h4-18,22-29H,1-3,19-21H2/t4-,5+,6+,7+,8+,9+,10+,11+,12-,13+,14-,15+,16-,17+,18+/m0/s1 |
| InChIKey | UPPJKCYSMDGLRE-DNBVWFFRSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3''-deamino-3''-hydroxykanamycin C (CHEBI:73078) has functional parent kanamycin C (CHEBI:28185) |
| 3''-deamino-3''-hydroxykanamycin C (CHEBI:73078) is a kanamycins (CHEBI:24951) |
| 3''-deamino-3''-hydroxykanamycin C (CHEBI:73078) is conjugate base of 3''-deamino-3''-hydroxykanamycin C(3+) (CHEBI:72945) |
| Incoming Relation(s) |
| 3''-deamino-3''-hydroxykanamycin C(3+) (CHEBI:72945) is conjugate acid of 3''-deamino-3''-hydroxykanamycin C (CHEBI:73078) |
| IUPAC Name |
|---|
| (1S,2S,3R,4S,6R)-4,6-diamino-3-[(2-amino-2-deoxy-α-D-glucopyranosyl)oxy]-2-hydroxycyclohexyl α-D-glucopyranoside |
| Manual Xrefs | Databases |
|---|---|
| C17999 | KEGG COMPOUND |
| Citations |
|---|