EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H36N4O11 |
| Net Charge | 0 |
| Average Mass | 484.503 |
| Monoisotopic Mass | 484.23806 |
| SMILES | N[C@@H]1[C@@H](O)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H](N)C[C@H]2N)O[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C18H36N4O11/c19-4-1-5(20)16(33-18-13(28)8(21)10(25)6(2-23)31-18)14(29)15(4)32-17-9(22)12(27)11(26)7(3-24)30-17/h4-18,23-29H,1-3,19-22H2/t4-,5+,6+,7+,8-,9+,10+,11+,12+,13+,14-,15+,16-,17+,18+/m0/s1 |
| InChIKey | WZDRWYJKESFZMB-FQSMHNGLSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kanamycin C (CHEBI:28185) is a kanamycins (CHEBI:24951) |
| kanamycin C (CHEBI:28185) is conjugate base of kanamycin C(4+) (CHEBI:72755) |
| Incoming Relation(s) |
| 3''-deamino-3''-hydroxykanamycin C (CHEBI:73078) has functional parent kanamycin C (CHEBI:28185) |
| kanamycin (CHEBI:6104) has part kanamycin C (CHEBI:28185) |
| kanamycin C(4+) (CHEBI:72755) is conjugate acid of kanamycin C (CHEBI:28185) |
| IUPAC Name |
|---|
| (1R,2S,3S,4R,6S)-4,6-diamino-3-(3-amino-3-deoxy-α-D-glucopyranosyloxy)-2-hydroxycyclohexyl 2-amino-2-deoxy-α-D-glucopyranoside |
| Synonym | Source |
|---|---|
| Kanamycin C | KEGG COMPOUND |