EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13ClFNO2 |
| Net Charge | 0 |
| Average Mass | 293.725 |
| Monoisotopic Mass | 293.06188 |
| SMILES | Cc1ccc(Nc2c(F)cccc2Cl)c(CC(=O)O)c1 |
| InChI | InChI=1S/C15H13ClFNO2/c1-9-5-6-13(10(7-9)8-14(19)20)18-15-11(16)3-2-4-12(15)17/h2-7,18H,8H2,1H3,(H,19,20) |
| InChIKey | KHPKQFYUPIUARC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. |
| Application: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lumiracoxib (CHEBI:73044) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| lumiracoxib (CHEBI:73044) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| lumiracoxib (CHEBI:73044) is a amino acid (CHEBI:33709) |
| lumiracoxib (CHEBI:73044) is a monocarboxylic acid (CHEBI:25384) |
| lumiracoxib (CHEBI:73044) is a organochlorine compound (CHEBI:36683) |
| lumiracoxib (CHEBI:73044) is a organofluorine compound (CHEBI:37143) |
| lumiracoxib (CHEBI:73044) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| {2-[(2-chloro-6-fluorophenyl)amino]-5-methylphenyl}acetic acid |
| INNs | Source |
|---|---|
| lumiracoxib | WHO MedNet |
| lumiracoxib | WHO MedNet |
| lumiracoxibum | WHO MedNet |
| lumiracoxib | WHO MedNet |
| Synonyms | Source |
|---|---|
| COX-189 | ChemIDplus |
| COX189 | ChemIDplus |
| COX 189 | ChemIDplus |
| 2-((2-chloro-6-fluorophenyl)amino)-5-methylbenzeneacetic acid | ChemIDplus |
| Brand Name | Source |
|---|---|
| Prexige | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D03714 | KEGG DRUG |
| DB01283 | DrugBank |
| LUR | PDBeChem |
| Lumiracoxib | Wikipedia |
| HMDB0015403 | HMDB |
| 1618 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9784107 | Reaxys |
| CAS:220991-20-8 | ChemIDplus |
| CAS:220991-20-8 | KEGG DRUG |
| Citations |
|---|