EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14F3N3O3S |
| Net Charge | 0 |
| Average Mass | 397.378 |
| Monoisotopic Mass | 397.07080 |
| SMILES | COc1ccc(-c2cc(C(F)F)nn2-c2ccc(S(N)(=O)=O)cc2)cc1F |
| InChI | InChI=1S/C17H14F3N3O3S/c1-26-16-7-2-10(8-13(16)18)15-9-14(17(19)20)22-23(15)11-3-5-12(6-4-11)27(21,24)25/h2-9,17H,1H3,(H2,21,24,25) |
| InChIKey | WAZQAZKAZLXFMK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deracoxib (CHEBI:73032) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| deracoxib (CHEBI:73032) has role non-narcotic analgesic (CHEBI:35481) |
| deracoxib (CHEBI:73032) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| deracoxib (CHEBI:73032) is a organofluorine compound (CHEBI:37143) |
| deracoxib (CHEBI:73032) is a pyrazoles (CHEBI:26410) |
| deracoxib (CHEBI:73032) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 4-[3-(difluoromethyl)-5-(3-fluoro-4-methoxyphenyl)-1H-pyrazol-1-yl]benzenesulfonamide |
| INNs | Source |
|---|---|
| deracoxib | WHO MedNet |
| deracoxib | WHO MedNet |
| déracoxib | WHO MedNet |
| deracoxibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| NSC-758935 | ChEMBL |
| SC 046 | ChemIDplus |
| SC 46 | ChemIDplus |
| SC 59046 | ChemIDplus |
| SC-59046 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Deramaxx | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7727810 | Reaxys |
| CAS:169590-41-4 | KEGG DRUG |
| CAS:169590-41-4 | ChemIDplus |
| Citations |
|---|