EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11NO3 |
| Net Charge | 0 |
| Average Mass | 157.169 |
| Monoisotopic Mass | 157.07389 |
| SMILES | C/C=C(\C)C(=O)NCC(=O)O |
| InChI | InChI=1S/C7H11NO3/c1-3-5(2)7(11)8-4-6(9)10/h3H,4H2,1-2H3,(H,8,11)(H,9,10)/b5-3+ |
| InChIKey | WRUSVQOKJIDBLP-HWKANZROSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tiglylglycine (CHEBI:73018) has functional parent glycine (CHEBI:15428) |
| tiglylglycine (CHEBI:73018) has role metabolite (CHEBI:25212) |
| tiglylglycine (CHEBI:73018) is a N-acylglycine (CHEBI:16180) |
| IUPAC Name |
|---|
| N-[(2E)-2-methylbut-2-enoyl]glycine |
| Synonym | Source |
|---|---|
| N-Tiglylglycine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000959 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2206218 | Reaxys |
| CAS:35842-45-6 | ChemIDplus |