EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O3 |
| Net Charge | 0 |
| Average Mass | 294.435 |
| Monoisotopic Mass | 294.21949 |
| SMILES | CCCCC/C=C\C=C\C(=O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H30O3/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21/h6,8,11,14H,2-5,7,9-10,12-13,15-16H2,1H3,(H,20,21)/b8-6-,14-11+ |
| InChIKey | LUZSWWYKKLTDHU-ZJHFMPGASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-oxo-ODE (CHEBI:72842) has functional parent 9-HODE (CHEBI:72651) |
| 9-oxo-ODE (CHEBI:72842) has role metabolite (CHEBI:25212) |
| 9-oxo-ODE (CHEBI:72842) is a 9-oxo-10,12-octadecadienoic acid (CHEBI:746952) |
| 9-oxo-ODE (CHEBI:72842) is a enone (CHEBI:51689) |
| 9-oxo-ODE (CHEBI:72842) is a oxooctadecadienoic acid (CHEBI:72812) |
| 9-oxo-ODE (CHEBI:72842) is conjugate acid of 9-oxo-ODE(1−) (CHEBI:133845) |
| Incoming Relation(s) |
| 9-oxo-ODE(1−) (CHEBI:133845) is conjugate base of 9-oxo-ODE (CHEBI:72842) |
| IUPAC Name |
|---|
| (10E,12Z)-9-oxooctadeca-10,12-dienoic acid |
| Synonyms | Source |
|---|---|
| 9-KODE | KEGG COMPOUND |
| 9-oxoODE | ChEBI |
| 9-oxo-10E,12Z-octadecadienoic acid | LIPID MAPS |
| 9-keto-10E,12Z-octadecadienoic acid | ChEBI |
| (10E,12Z)-9-Oxooctadeca-10,12-dienoic acid | KEGG COMPOUND |
| (10E,12Z)9-oxo-ODE | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA02000274 | LIPID MAPS |
| HMDB0004669 | HMDB |
| C14766 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4318269 | Reaxys |