EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H29O3 |
| Net Charge | -1 |
| Average Mass | 293.427 |
| Monoisotopic Mass | 293.21222 |
| SMILES | CCCCC/C=C\C=C\C(=O)CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H30O3/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21/h6,8,11,14H,2-5,7,9-10,12-13,15-16H2,1H3,(H,20,21)/p-1/b8-6-,14-11+ |
| InChIKey | LUZSWWYKKLTDHU-ZJHFMPGASA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-oxo-ODE(1−) (CHEBI:133845) is a long-chain fatty acid anion (CHEBI:57560) |
| 9-oxo-ODE(1−) (CHEBI:133845) is a octadecanoid anion (CHEBI:131860) |
| 9-oxo-ODE(1−) (CHEBI:133845) is a oxo fatty acid anion (CHEBI:59836) |
| 9-oxo-ODE(1−) (CHEBI:133845) is conjugate base of 9-oxo-ODE (CHEBI:72842) |
| Incoming Relation(s) |
| 9-oxo-ODE (CHEBI:72842) is conjugate acid of 9-oxo-ODE(1−) (CHEBI:133845) |
| IUPAC Name |
|---|
| (10E,12Z)-9-oxooctadeca-10,12-dienoate |
| Synonyms | Source |
|---|---|
| (10E,12Z)-9-oxooctadecadienoate | ChEBI |
| 9-keto-ODE(1−) | ChEBI |
| 9-ketoODE(1−) | SUBMITTER |
| 9-oxoODE(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 9-oxo-(10E,12Z)-octadecadienoate | UniProt |
| Citations |
|---|