EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H41N3O7 |
| Net Charge | 0 |
| Average Mass | 579.694 |
| Monoisotopic Mass | 579.29445 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@]1(O)[C@@H](OCC=C(C)C)c3c4n(c5cc(OC)ccc35)[C@@H](C=C(C)C)OOC(C)(C)C[C@]4([H])N1C2=O |
| InChI | InChI=1S/C32H41N3O7/c1-18(2)12-14-40-28-26-21-11-10-20(39-7)16-23(21)34-25(15-19(3)4)41-42-31(5,6)17-24(27(26)34)35-29(36)22-9-8-13-33(22)30(37)32(28,35)38/h10-12,15-16,22,24-25,28,38H,8-9,13-14,17H2,1-7H3/t22-,24-,25+,28-,32+/m0/s1 |
| InChIKey | ACGHJVZDNQZJOV-BMOJZYMJSA-N |
| Roles Classification |
|---|
| Chemical Role: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. |
| Biological Roles: | mycotoxin Poisonous substance produced by fungi. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fumitremorgin A (CHEBI:72766) has functional parent verruculogen (CHEBI:72765) |
| fumitremorgin A (CHEBI:72766) has role mycotoxin (CHEBI:25442) |
| fumitremorgin A (CHEBI:72766) is a aromatic ether (CHEBI:35618) |
| fumitremorgin A (CHEBI:72766) is a diol (CHEBI:23824) |
| fumitremorgin A (CHEBI:72766) is a indole alkaloid (CHEBI:38958) |
| fumitremorgin A (CHEBI:72766) is a organic heterohexacyclic compound (CHEBI:51914) |
| fumitremorgin A (CHEBI:72766) is a organic peroxide (CHEBI:25702) |
| IUPAC Name |
|---|
| (5R,10S,10aR,14aS,15bS)-10a-hydroxy-7-methoxy-2,2-dimethyl-10-[(3-methylbut-2-en-1-yl)oxy]-5-(2-methylprop-1-en-1-yl)-1,10,10a,14,14a,15b-hexahydro-12H-3,4-dioxa-5a,11a,15a-triazacycloocta[1,2,3-lm]indeno[5,6-b]fluorene-11,15(H,13H)-dione |
| UniProt Name | Source |
|---|---|
| fumitremorgin A | UniProt |
| Manual Xrefs | Databases |
|---|---|
| US2002156015 | Patent |
| US2002169111 | Patent |
| US2003083230 | Patent |
| US6878737 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5421531 | Reaxys |
| CAS:12626-18-5 | ChemIDplus |
| Citations |
|---|