EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H43NO8S |
| Net Charge | 0 |
| Average Mass | 529.696 |
| Monoisotopic Mass | 529.27094 |
| SMILES | [H][C@@]12C[C@H](OS(=O)(=O)O)CC[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC(=O)NCC(=O)O)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C26H43NO8S/c1-15(4-7-22(29)27-14-23(30)31)18-5-6-19-24-20(9-11-26(18,19)3)25(2)10-8-17(35-36(32,33)34)12-16(25)13-21(24)28/h15-21,24,28H,4-14H2,1-3H3,(H,27,29)(H,30,31)(H,32,33,34)/t15-,16+,17-,18-,19+,20+,21-,24+,25+,26-/m1/s1 |
| InChIKey | DKXXSIJHWWVNMO-GYPHWSFCSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfoglycochenodeoxycholic acid (CHEBI:72733) has functional parent glycochenodeoxycholic acid (CHEBI:36274) |
| sulfoglycochenodeoxycholic acid (CHEBI:72733) has role metabolite (CHEBI:25212) |
| sulfoglycochenodeoxycholic acid (CHEBI:72733) is a 7α-hydroxy steroid (CHEBI:36843) |
| sulfoglycochenodeoxycholic acid (CHEBI:72733) is a bile acid glycine conjugate (CHEBI:36255) |
| sulfoglycochenodeoxycholic acid (CHEBI:72733) is a steroid sulfate (CHEBI:16158) |
| sulfoglycochenodeoxycholic acid (CHEBI:72733) is conjugate acid of glycochenodeoxycholate 3-sulfate(2−) (CHEBI:234533) |
| Incoming Relation(s) |
| glycochenodeoxycholate 3-sulfate(2−) (CHEBI:234533) is conjugate base of sulfoglycochenodeoxycholic acid (CHEBI:72733) |
| IUPAC Name |
|---|
| N-[(3α,5β,7α)-7-hydroxy-24-oxo-3-(sulfooxy)cholan-24-yl]glycine |
| Synonyms | Source |
|---|---|
| 3-sulfo-GCDCA | ChEBI |
| GCDCS | ChemIDplus |
| Glycochenodeoxycholate-3-sulfate | HMDB |
| Glycochenodeoxycholate-3-sulphate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0002497 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:67030-54-0 | ChemIDplus |
| Citations |
|---|