EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H43NO5 |
| Net Charge | 0 |
| Average Mass | 449.632 |
| Monoisotopic Mass | 449.31412 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC(=O)NCC(=O)O)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C26H43NO5/c1-15(4-7-22(30)27-14-23(31)32)18-5-6-19-24-20(9-11-26(18,19)3)25(2)10-8-17(28)12-16(25)13-21(24)29/h15-21,24,28-29H,4-14H2,1-3H3,(H,27,30)(H,31,32)/t15-,16+,17-,18-,19+,20+,21-,24+,25+,26-/m1/s1 |
| InChIKey | GHCZAUBVMUEKKP-GYPHWSFCSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (23078175) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycochenodeoxycholic acid (CHEBI:36274) has functional parent chenodeoxycholic acid (CHEBI:16755) |
| glycochenodeoxycholic acid (CHEBI:36274) has role human metabolite (CHEBI:77746) |
| glycochenodeoxycholic acid (CHEBI:36274) is a bile acid glycine conjugate (CHEBI:36255) |
| glycochenodeoxycholic acid (CHEBI:36274) is conjugate acid of glycochenodeoxycholate (CHEBI:36252) |
| Incoming Relation(s) |
| glycocholic acid (CHEBI:17687) has functional parent glycochenodeoxycholic acid (CHEBI:36274) |
| sulfoglycochenodeoxycholic acid (CHEBI:72733) has functional parent glycochenodeoxycholic acid (CHEBI:36274) |
| glycochenodeoxycholate (CHEBI:36252) is conjugate base of glycochenodeoxycholic acid (CHEBI:36274) |
| IUPAC Names |
|---|
| [(3α,7α-dihydroxy-24-oxo-5β-cholan-24-yl)amino]acetic acid |
| N-(3α,7α-dihydroxy-5β-cholan-24-oyl)glycine |
| Synonyms | Source |
|---|---|
| Glycochenodeoxycholate | KEGG COMPOUND |
| GLYCOCHENODEOXYCHOLIC ACID | PDBeChem |
| glycine chenodeoxycholate | ChemIDplus |
| chenodeoxycholylglycine | ChemIDplus |
| chenodeoxyglycocholic acid | ChEBI |
| Chenodeoxyglycocholate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05466 | KEGG COMPOUND |
| CHO | PDBeChem |
| DB02123 | DrugBank |
| HMDB0006898 | HMDB |
| GLYCOCHENODEOXYCHOLIC_ACID | MetaCyc |
| Glycochenodeoxycholic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3226177 | Beilstein |
| Reaxys:3226177 | Reaxys |
| CAS:640-79-9 | ChemIDplus |
| CAS:640-79-9 | KEGG COMPOUND |
| Citations |
|---|