EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20N2O3 |
| Net Charge | 0 |
| Average Mass | 312.369 |
| Monoisotopic Mass | 312.14739 |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H20N2O3/c19-15(11-13-7-3-1-4-8-13)17(21)20-16(18(22)23)12-14-9-5-2-6-10-14/h1-10,15-16H,11-12,19H2,(H,20,21)(H,22,23)/t15-,16-/m0/s1 |
| InChIKey | GKZIWHRNKRBEOH-HOTGVXAUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| blood serum (BTO:0000133) | MetaboLights (MTBLS90) | ||
| saliva (UBERON:0001836) | PubMed (22308371) | ||
| urine (BTO:0001419) | PubMed (19309105) | ||
| Mycoplasma genitalium (ncbitaxon:2097) | - | PubMed (22817898) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Mycoplasma genitalium metabolite Any bacterial metabolite produced during a metabolic reaction in Mycoplasma genitalium. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phe-Phe (CHEBI:72723) has functional parent L-phenylalanine (CHEBI:17295) |
| Phe-Phe (CHEBI:72723) has role Mycoplasma genitalium metabolite (CHEBI:131604) |
| Phe-Phe (CHEBI:72723) has role human blood serum metabolite (CHEBI:85234) |
| Phe-Phe (CHEBI:72723) is a dipeptide (CHEBI:46761) |
| Phe-Phe (CHEBI:72723) is tautomer of Phe-Phe zwitterion (CHEBI:191205) |
| Incoming Relation(s) |
| Phe-Phe zwitterion (CHEBI:191205) is tautomer of Phe-Phe (CHEBI:72723) |
| IUPAC Name |
|---|
| L-phenylalanyl-L-phenylalanine |
| Synonyms | Source |
|---|---|
| (2S)-2-{[(2S)-2-amino-3-phenylpropanoyl]amino}-3-phenylpropanoic acid | IUPAC |
| FF | ChEBI |
| H-Phe-Phe-OH | ChEBI |
| H-L-Phe-L-Phe-OH | ChEBI |
| phenylalanylphenylalanine | ChEBI |
| Phe-Phe | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013302 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2818640 | Reaxys |
| CAS:2577-40-4 | ChemIDplus |
| Citations |
|---|