EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20N2O3 |
| Net Charge | 0 |
| Average Mass | 312.369 |
| Monoisotopic Mass | 312.14739 |
| SMILES | [NH3+][C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C18H20N2O3/c19-15(11-13-7-3-1-4-8-13)17(21)20-16(18(22)23)12-14-9-5-2-6-10-14/h1-10,15-16H,11-12,19H2,(H,20,21)(H,22,23)/t15-,16-/m0/s1 |
| InChIKey | GKZIWHRNKRBEOH-HOTGVXAUSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phe-Phe zwitterion (CHEBI:191205) is a L-aminoacyl-L-amino acid zwitterion (CHEBI:77460) |
| Phe-Phe zwitterion (CHEBI:191205) is tautomer of Phe-Phe (CHEBI:72723) |
| Incoming Relation(s) |
| Phe-Phe (CHEBI:72723) is tautomer of Phe-Phe zwitterion (CHEBI:191205) |
| IUPAC Name |
|---|
| (2S)-2-{[(2S)-2-azaniumyl-3-phenylpropanoyl]amino}-3-phenylpropanoate |
| Synonyms | Source |
|---|---|
| FF dipeptide zwitterion | ChEBI |
| FF zwitterion | ChEBI |
| L-phenylalanyl-L-phenylalanine zwitterion | ChEBI |
| L-Phe-L-Phe zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| L-phenylalanyl-L-phenylalanine | UniProt |
| Citations |
|---|