EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9O6 |
| Net Charge | -3 |
| Average Mass | 213.165 |
| Monoisotopic Mass | 213.04156 |
| SMILES | O=C([O-])/C=C(/CCCCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C9H12O6/c10-7(11)4-2-1-3-6(9(14)15)5-8(12)13/h5H,1-4H2,(H,10,11)(H,12,13)(H,14,15)/p-3/b6-5- |
| InChIKey | NGULBISQWGMRGK-WAYWQWQTSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-trihomoaconitate(3−) (CHEBI:72712) is a tricarboxylic acid trianion (CHEBI:27092) |
| cis-trihomoaconitate(3−) (CHEBI:72712) is conjugate base of cis-trihomoaconitic acid (CHEBI:72711) |
| Incoming Relation(s) |
| cis-trihomoaconitic acid (CHEBI:72711) is conjugate acid of cis-trihomoaconitate(3−) (CHEBI:72712) |
| IUPAC Name |
|---|
| (1Z)-hex-1-ene-1,2,6-tricarboxylate |
| Synonyms | Source |
|---|---|
| cis-(homo)3aconitate | MetaCyc |
| cis-(homo)3aconitate(3−) | SUBMITTER |
| (Z)-1,2,6-hex-1-enetricarboxylate(3−) | SUBMITTER |
| (Z)-trihomoaconitate(3−) | MetaCyc |
| UniProt Name | Source |
|---|---|
| cis-(homo)3aconitate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-319 | MetaCyc |