EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12O6 |
| Net Charge | 0 |
| Average Mass | 216.189 |
| Monoisotopic Mass | 216.06339 |
| SMILES | O=C(O)/C=C(/CCCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H12O6/c10-7(11)4-2-1-3-6(9(14)15)5-8(12)13/h5H,1-4H2,(H,10,11)(H,12,13)(H,14,15)/b6-5- |
| InChIKey | NGULBISQWGMRGK-WAYWQWQTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-trihomoaconitic acid (CHEBI:72711) is a tricarboxylic acid (CHEBI:27093) |
| cis-trihomoaconitic acid (CHEBI:72711) is conjugate acid of cis-trihomoaconitate(3−) (CHEBI:72712) |
| Incoming Relation(s) |
| cis-trihomoaconitate(3−) (CHEBI:72712) is conjugate base of cis-trihomoaconitic acid (CHEBI:72711) |
| IUPAC Name |
|---|
| (1Z)-hex-1-ene-1,2,6-tricarboxylic acid |
| Synonyms | Source |
|---|---|
| cis-(homo)3aconitic acid | SUBMITTER |
| (Z)-1,2,6-hex-1-enetricarboxylic acid | SUBMITTER |
| (Z)-trihomoaconitic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-319 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21144464 | Reaxys |