EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11O7 |
| Net Charge | -3 |
| Average Mass | 231.180 |
| Monoisotopic Mass | 231.05212 |
| SMILES | O=C([O-])CCCC[C@@](O)(CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C9H14O7/c10-6(11)3-1-2-4-9(16,8(14)15)5-7(12)13/h16H,1-5H2,(H,10,11)(H,12,13)(H,14,15)/p-3/t9-/m1/s1 |
| InChIKey | YNPKOQYWJZNZGP-SECBINFHSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-trihomocitrate(3−) (CHEBI:72699) is a tricarboxylic acid trianion (CHEBI:27092) |
| (2R)-trihomocitrate(3−) (CHEBI:72699) is conjugate base of (2R)-trihomocitric acid (CHEBI:72698) |
| Incoming Relation(s) |
| (2R)-trihomocitric acid (CHEBI:72698) is conjugate acid of (2R)-trihomocitrate(3−) (CHEBI:72699) |
| IUPAC Name |
|---|
| (2R)-2-hydroxy-1,2,6-hexanetricarboxylate |
| Synonyms | Source |
|---|---|
| (2R)-(homo)3citrate(3−) | MetaCyc |
| (R)-trihomocitrate(3−) | ChEBI |
| UniProt Name | Source |
|---|---|
| (R)-trihomocitrate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-301 | MetaCyc |