EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14O7 |
| Net Charge | 0 |
| Average Mass | 234.204 |
| Monoisotopic Mass | 234.07395 |
| SMILES | O=C(O)CCCC[C@@](O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H14O7/c10-6(11)3-1-2-4-9(16,8(14)15)5-7(12)13/h16H,1-5H2,(H,10,11)(H,12,13)(H,14,15)/t9-/m1/s1 |
| InChIKey | YNPKOQYWJZNZGP-SECBINFHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis cerana (ncbitaxon:7461) | - | MetaboLights (MTBLS379) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-trihomocitric acid (CHEBI:72698) is a tricarboxylic acid (CHEBI:27093) |
| (2R)-trihomocitric acid (CHEBI:72698) is conjugate acid of (2R)-trihomocitrate(3−) (CHEBI:72699) |
| Incoming Relation(s) |
| (2R)-trihomocitrate(3−) (CHEBI:72699) is conjugate base of (2R)-trihomocitric acid (CHEBI:72698) |
| IUPAC Name |
|---|
| (2R)-2-hydroxy-1,2,6-hexanetricarboxylic acid |
| Synonyms | Source |
|---|---|
| (2R)-(homo)3citric acid | SUBMITTER |
| (R)-trihomocitric acid | ChEBI |
| (R)-2-Hydroxy-1,2,6-hexanetricarboxylic acid | KEGG COMPOUND |