EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11N3O4 |
| Net Charge | 0 |
| Average Mass | 273.248 |
| Monoisotopic Mass | 273.07496 |
| SMILES | Nc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C13H11N3O4/c14-7-3-1-2-6-10(7)13(20)16(12(6)19)8-4-5-9(17)15-11(8)18/h1-3,8H,4-5,14H2,(H,15,17,18) |
| InChIKey | UVSMNLNDYGZFPF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| Applications: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pomalidomide (CHEBI:72690) has functional parent thalidomide (CHEBI:9513) |
| pomalidomide (CHEBI:72690) has role angiogenesis inhibitor (CHEBI:48422) |
| pomalidomide (CHEBI:72690) has role antineoplastic agent (CHEBI:35610) |
| pomalidomide (CHEBI:72690) has role immunomodulator (CHEBI:50846) |
| pomalidomide (CHEBI:72690) is a aromatic amine (CHEBI:33860) |
| pomalidomide (CHEBI:72690) is a dicarboximide (CHEBI:35356) |
| pomalidomide (CHEBI:72690) is a isoindoles (CHEBI:24897) |
| pomalidomide (CHEBI:72690) is a piperidones (CHEBI:48589) |
| IUPAC Name |
|---|
| 4-amino-2-(2,6-dioxopiperidin-3-yl)-1H-isoindole-1,3(2H)-dione |
| INN | Source |
|---|---|
| pomalidomide | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 4-Aminothalidomide | ChemIDplus |
| 4-Amino-2-(2,6-dioxo-3-piperidyl)isoindoline-1,3-dione | ChemIDplus |
| 3-Amino-N-(2,6-dioxo-3-piperidyl)phthalimide | ChemIDplus |
| CC 4047 | ChemIDplus |
| CC-4047 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Pomalyst | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D08976 | KEGG DRUG |
| US2007004920 | Patent |
| US2007155791 | Patent |
| US2007048327 | Patent |
| Pomalidomide | Wikipedia |
| 4746 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8340987 | Reaxys |
| CAS:19171-19-8 | KEGG DRUG |
| CAS:19171-19-8 | ChemIDplus |
| Citations |
|---|