EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11N3O4 |
| Net Charge | 0 |
| Average Mass | 273.248 |
| Monoisotopic Mass | 273.07496 |
| SMILES | Nc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C13H11N3O4/c14-7-3-1-2-6-10(7)13(20)16(12(6)19)8-4-5-9(17)15-11(8)18/h1-3,8H,4-5,14H2,(H,15,17,18) |
| InChIKey | UVSMNLNDYGZFPF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| Applications: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifibrotic agent Any agent which acts to reduce fibrosis. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pomalidomide (CHEBI:72690) has functional parent thalidomide (CHEBI:9513) |
| pomalidomide (CHEBI:72690) has role angiogenesis inhibitor (CHEBI:48422) |
| pomalidomide (CHEBI:72690) has role anti-anaemic agent (CHEBI:75835) |
| pomalidomide (CHEBI:72690) has role antifibrotic agent (CHEBI:233423) |
| pomalidomide (CHEBI:72690) has role antineoplastic agent (CHEBI:35610) |
| pomalidomide (CHEBI:72690) has role immunomodulator (CHEBI:50846) |
| pomalidomide (CHEBI:72690) is a aromatic amine (CHEBI:33860) |
| pomalidomide (CHEBI:72690) is a dicarboximide (CHEBI:35356) |
| pomalidomide (CHEBI:72690) is a isoindoles (CHEBI:24897) |
| pomalidomide (CHEBI:72690) is a piperidones (CHEBI:48589) |
| IUPAC Name |
|---|
| 4-amino-2-(2,6-dioxopiperidin-3-yl)-1H-isoindole-1,3(2H)-dione |
| INNs | Source |
|---|---|
| pomalidomida | WHO MedNet |
| pomalidomide | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 3-Amino-N-(2,6-dioxo-3-piperidyl)phthalimide | ChemIDplus |
| 4-Amino-2-(2,6-dioxo-3-piperidyl)isoindoline-1,3-dione | ChemIDplus |
| 4-Aminothalidomide | ChemIDplus |
| CC 4047 | ChemIDplus |
| CC-4047 | ChemIDplus |
| IMID 3 | ChEMBL |
| Brand Names | Source |
|---|---|
| Imnovid | ChEMBL |
| Imnovid (previously pomalidomide celgene) | ChEMBL |
| Pomalidomide accord | ChEMBL |
| Pomalidomide krka | ChEMBL |
| Pomalidomide viatris | ChEMBL |
| Pomalidomide zentiva | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4746 | DrugCentral |
| D08976 | KEGG DRUG |
| Pomalidomide | Wikipedia |
| US2007004920 | Patent |
| US2007048327 | Patent |
| US2007155791 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8340987 | Reaxys |
| CAS:19171-19-8 | ChemIDplus |
| CAS:19171-19-8 | KEGG DRUG |
| Citations |
|---|