EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O3 |
| Net Charge | 0 |
| Average Mass | 318.457 |
| Monoisotopic Mass | 318.21949 |
| SMILES | [H][C@@]12C(=O)C=C(C=C)[C@@H](C)[C@@]1([H])CC[C@]1([H])C(C)(C)[C@H](O)C[C@H](O)[C@@]21C |
| InChI | InChI=1S/C20H30O3/c1-6-12-9-14(21)18-13(11(12)2)7-8-15-19(3,4)16(22)10-17(23)20(15,18)5/h6,9,11,13,15-18,22-23H,1,7-8,10H2,2-5H3/t11-,13-,15-,16-,17+,18+,20+/m1/s1 |
| InChIKey | YQESGDRIAQDEQE-ONNBHGNJSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. phytoalexin A toxin made by a plant that acts against an organism attacking it. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-phytocassane C (CHEBI:72668) is a diol (CHEBI:23824) |
| (+)-phytocassane C (CHEBI:72668) is a phytocassane (CHEBI:139395) |
| IUPAC Name |
|---|
| 1α,3α-dihydroxy-14β-methyl-13-vinyl-5β,8α,9β,10α-podocarp-12-en-11-one |
| Synonyms | Source |
|---|---|
| (1S,4aR,4bR,5S,7R,8aR,10aR)-5,7-dihydroxy-1,4b,8,8-tetramethyl-2-vinyl-4a,4b,5,6,7,8,8a,9,10,10a-decahydrophenanthren-4(1H)-one | IUPAC |
| (1S,4aR,4bR,5S,7R,8aR,10aR)-5,7-dihydroxy-2-ethenyl-1,4b,8,8-tetramethyl-4a,4b,5,6,7,8,8a,9,10,10a-decahydrophenanthren-4(1H)-one | IUPAC |
| (1α,3α,5β,8α,9β,10α,14β)-1,3-dihydroxy-14-methyl-13-vinylpodocarp-12-en-11-one | IUPAC |
| phytocassane C | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0041058 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15793550 | Reaxys |