EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O3 |
| Net Charge | 0 |
| Average Mass | 318.457 |
| Monoisotopic Mass | 318.21949 |
| SMILES | [H][C@@]12C(=O)C=C(C=C)[C@@H](C)[C@@]1([H])CC[C@]1([H])C(C)(C)[C@H](O)C[C@H](O)[C@@]21C |
| InChI | InChI=1S/C20H30O3/c1-6-12-9-14(21)18-13(11(12)2)7-8-15-19(3,4)16(22)10-17(23)20(15,18)5/h6,9,11,13,15-18,22-23H,1,7-8,10H2,2-5H3/t11-,13-,15-,16-,17+,18+,20+/m1/s1 |
| InChIKey | YQESGDRIAQDEQE-ONNBHGNJSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. phytoalexin A toxin made by a plant that acts against an organism attacking it. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-phytocassane C (CHEBI:72668) is a diol (CHEBI:23824) |
| (+)-phytocassane C (CHEBI:72668) is a phytocassane (CHEBI:139395) |
| IUPAC Name |
|---|
| 1α,3α-dihydroxy-14β-methyl-13-vinyl-5β,8α,9β,10α-podocarp-12-en-11-one |
| Synonyms | Source |
|---|---|
| (1S,4aR,4bR,5S,7R,8aR,10aR)-5,7-dihydroxy-1,4b,8,8-tetramethyl-2-vinyl-4a,4b,5,6,7,8,8a,9,10,10a-decahydrophenanthren-4(1H)-one | IUPAC |
| (1S,4aR,4bR,5S,7R,8aR,10aR)-5,7-dihydroxy-2-ethenyl-1,4b,8,8-tetramethyl-4a,4b,5,6,7,8,8a,9,10,10a-decahydrophenanthren-4(1H)-one | IUPAC |
| (1α,3α,5β,8α,9β,10α,14β)-1,3-dihydroxy-14-methyl-13-vinylpodocarp-12-en-11-one | IUPAC |
| phytocassane C | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0041058 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15793550 | Reaxys |