EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O3 |
| Net Charge | 0 |
| Average Mass | 316.441 |
| Monoisotopic Mass | 316.20384 |
| SMILES | [H][C@@]12C(=O)C=C(C=C)[C@@H](C)[C@@]1([H])CC[C@]1([H])C(C)(C)C(=O)[C@H](O)C[C@@]21C |
| InChI | InChI=1S/C20H28O3/c1-6-12-9-14(21)17-13(11(12)2)7-8-16-19(3,4)18(23)15(22)10-20(16,17)5/h6,9,11,13,15-17,22H,1,7-8,10H2,2-5H3/t11-,13-,15-,16-,17+,20-/m1/s1 |
| InChIKey | XVEOIKIXOSKAFL-BJASISCMSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. phytoalexin A toxin made by a plant that acts against an organism attacking it. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-phytocassane A (CHEBI:72664) is a diketone (CHEBI:46640) |
| (+)-phytocassane A (CHEBI:72664) is a phytocassane (CHEBI:139395) |
| (+)-phytocassane A (CHEBI:72664) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| 2α-hydroxy-14β-methyl-13-vinyl-5β,8α,9β,10α-podocarp-12-ene-3,11-dione |
| Synonyms | Source |
|---|---|
| (2α,5β,8α,9β,10α,14β)-2-hydroxy-14-methyl-13-vinylpodocarp-12-ene-3,11-dione | IUPAC |
| (3R,4aR,4bR,8S,8aR,10aS)-3-hydroxy-1,1,4a,8-tetramethyl-7-vinyl-1,3,4,4a,4b,8,8a,9,10,10a-decahydrophenanthrene-2,5-dione | IUPAC |
| ent-2β-hydroxy-12,15-cassadiene-3,11-dione | ChEBI |
| phytocassane A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-7094 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8509348 | Reaxys |