EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H42O10 |
| Net Charge | 0 |
| Average Mass | 574.667 |
| Monoisotopic Mass | 574.27780 |
| SMILES | CC[C@H](C)CC/C=C/C=C(\C)[C@@H](O)C/C=C/C=C/C(=O)O[C@H]1[C@H](O)[C@@H](CO)O[C@]2(OCc3cc(O)cc(O)c32)[C@@H]1O |
| InChI | InChI=1S/C31H42O10/c1-4-19(2)11-7-5-8-12-20(3)23(34)13-9-6-10-14-26(36)40-29-28(37)25(17-32)41-31(30(29)38)27-21(18-39-31)15-22(33)16-24(27)35/h5-6,8-10,12,14-16,19,23,25,28-30,32-35,37-38H,4,7,11,13,17-18H2,1-3H3/b8-5+,9-6+,14-10+,20-12+/t19-,23-,25+,28+,29-,30+,31-/m0/s1 |
| InChIKey | XKSZJTQIZHUMGA-HPZFVNCBSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| papulacandin D (CHEBI:72630) has role antifungal agent (CHEBI:35718) |
| papulacandin D (CHEBI:72630) has role metabolite (CHEBI:25212) |
| papulacandin D (CHEBI:72630) is a monosaccharide derivative (CHEBI:63367) |
| papulacandin D (CHEBI:72630) is a organic heterotricyclic compound (CHEBI:26979) |
| papulacandin D (CHEBI:72630) is a papulacandin (CHEBI:72596) |
| IUPAC Name |
|---|
| (1S,3'R,4'S,5'R,6'R)-3',5,5',7-tetrahydroxy-6'-(hydroxymethyl)-3',4',5',6'-tetrahydro-3H-spiro[2-benzofuran-1,2'-pyran]-4'-yl (2E,4E,7S,8E,10E,14S)-7-hydroxy-8,14-dimethylhexadeca-2,4,8,10-tetraenoate |
| Synonyms | Source |
|---|---|
| (+)-papulacandin D | ChEBI |
| (+)-papulacandin-D | ChEBI |
| papulacandin-D | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7239678 | Reaxys |
| CAS:61036-49-5 | ChemIDplus |
| Citations |
|---|