EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O2 |
| Net Charge | 0 |
| Average Mass | 168.236 |
| Monoisotopic Mass | 168.11503 |
| SMILES | CCCCC/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C10H16O2/c1-2-3-4-5-6-7-8-9-10(11)12/h6-9H,2-5H2,1H3,(H,11,12)/b7-6+,9-8+ |
| InChIKey | YKHVVNDSWHSBPA-BLHCBFLLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,4E)-deca-2,4-dienoic acid (CHEBI:72614) is a medium-chain fatty acid (CHEBI:59554) |
| (2E,4E)-deca-2,4-dienoic acid (CHEBI:72614) is a polyunsaturated fatty acid (CHEBI:26208) |
| Incoming Relation(s) |
| ethyl (2E,4Z)-deca-2,4-dienoate (CHEBI:4896) has functional parent (2E,4E)-deca-2,4-dienoic acid (CHEBI:72614) |
| papulacandin A (CHEBI:72611) has functional parent (2E,4E)-deca-2,4-dienoic acid (CHEBI:72614) |
| Synonyms | Source |
|---|---|
| (2E,4E)-2,4-decadienoic acid | ChemIDplus |
| trans,trans-2,4-decadienoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721996 | Reaxys |
| CAS:30361-33-2 | ChemIDplus |