EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O2 |
| Net Charge | 0 |
| Average Mass | 196.290 |
| Monoisotopic Mass | 196.14633 |
| SMILES | CCCCC/C=C\C=C\C(=O)OCC |
| InChI | InChI=1S/C12H20O2/c1-3-5-6-7-8-9-10-11-12(13)14-4-2/h8-11H,3-7H2,1-2H3/b9-8-,11-10+ |
| InChIKey | OPCRGEVPIBLWAY-QNRZBPGKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. kairomone A semiochemical used for inter-species chemical communication in a way that benefits an individual of another species that receives the chemical signal. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | flavouring agent A food additive that is used to added improve the taste or odour of a food. fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl (2E,4Z)-deca-2,4-dienoate (CHEBI:4896) has functional parent (2E,4E)-deca-2,4-dienoic acid (CHEBI:72614) |
| ethyl (2E,4Z)-deca-2,4-dienoate (CHEBI:4896) has role flavouring agent (CHEBI:35617) |
| ethyl (2E,4Z)-deca-2,4-dienoate (CHEBI:4896) has role fragrance (CHEBI:48318) |
| ethyl (2E,4Z)-deca-2,4-dienoate (CHEBI:4896) has role kairomone (CHEBI:83074) |
| ethyl (2E,4Z)-deca-2,4-dienoate (CHEBI:4896) has role plant metabolite (CHEBI:76924) |
| ethyl (2E,4Z)-deca-2,4-dienoate (CHEBI:4896) is a fatty acid ethyl ester (CHEBI:78206) |
| IUPAC Name |
|---|
| ethyl (2E,4Z)-deca-2,4-dienoate |
| Synonyms | Source |
|---|---|
| Ethyl (2E,4Z)-decadienoate | ChEBI |
| ethyl 2-trans-4-cis-decadienoate | ChEBI |
| ethyl decadienoate | ChEBI |
| Ethyl trans-2,cis-4-decadienoate | KEGG COMPOUND |
| pear ester | ChEBI |
| WE(2:0/10:2(2E,4Z)) | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| C00001309 | KNApSAcK |
| C08486 | KEGG COMPOUND |
| Ethyl_decadienoate | Wikipedia |
| LMFA07010480 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1724176 | Reaxys |
| CAS:3025-30-7 | KEGG COMPOUND |
| Citations |
|---|