EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6N6O2 |
| Net Charge | 0 |
| Average Mass | 194.154 |
| Monoisotopic Mass | 194.05522 |
| SMILES | Cn1nnc2c(C(N)=O)ncn2c1=O |
| InChI | InChI=1S/C6H6N6O2/c1-11-6(14)12-2-8-3(4(7)13)5(12)9-10-11/h2H,1H3,(H2,7,13) |
| InChIKey | BPEGJWRSRHCHSN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| temozolomide (CHEBI:72564) has role alkylating agent (CHEBI:22333) |
| temozolomide (CHEBI:72564) has role antineoplastic agent (CHEBI:35610) |
| temozolomide (CHEBI:72564) has role prodrug (CHEBI:50266) |
| temozolomide (CHEBI:72564) is a imidazotetrazine (CHEBI:72565) |
| temozolomide (CHEBI:72564) is a monocarboxylic acid amide (CHEBI:29347) |
| temozolomide (CHEBI:72564) is a triazene derivative (CHEBI:72573) |
| IUPAC Name |
|---|
| 3-methyl-4-oxo-3,4-dihydroimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
| INNs | Source |
|---|---|
| temozolomida | WHO MedNet |
| temozolomide | ChemIDplus |
| témozolomide | WHO MedNet |
| temozolomidum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3,4-dihydro-3-methyl-4-oxoimidazo(5,1-d)-1,2,3,5-tetrazine-8-carboxamide | ChemIDplus |
| 3,4-dihydro-3-methyl-4-oxoimidazo(5,1-d)-as-tetrazine-8-carboxamide | ChemIDplus |
| 3-methyl-4-oxo-3,4-dihydroimidazo(5,1-d)(1,2,3,5)tetrazine-8-carboxamide | ChemIDplus |
| 8-carbamoyl-3-methylimidazo(5,1-d)-1,2,3,5-tetrazin-4(3H)-one | ChemIDplus |
| BRN 5547136 | ChemIDplus |
| CCRG 81045 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Temodal | KEGG DRUG |
| Temodar | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2589 | DrugCentral |
| D06067 | KEGG DRUG |
| DB00853 | DrugBank |
| DE3231255 | Patent |
| HMDB0014991 | HMDB |
| LSM-4590 | LINCS |
| Temozolomide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5547136 | Reaxys |
| CAS:85622-93-1 | ChemIDplus |
| Citations |
|---|