EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11N5O9 |
| Net Charge | 0 |
| Average Mass | 357.235 |
| Monoisotopic Mass | 357.05568 |
| SMILES | NC(=O)CC[C@H](Nc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C11H11N5O9/c12-9(17)2-1-6(11(18)19)13-10-7(15(22)23)3-5(14(20)21)4-8(10)16(24)25/h3-4,6,13H,1-2H2,(H2,12,17)(H,18,19)/t6-/m0/s1 |
| InChIKey | MNHDZOJOBSZDLO-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tnp-Gln (CHEBI:72495) has part 2,4,6-trinitrophenyl group (CHEBI:53067) |
| Tnp-Gln (CHEBI:72495) has role epitope (CHEBI:53000) |
| Tnp-Gln (CHEBI:72495) is a C-nitro compound (CHEBI:35716) |
| Tnp-Gln (CHEBI:72495) is a L-glutamine derivative (CHEBI:24317) |
| Tnp-Gln (CHEBI:72495) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| N2-(2,4,6-trinitrophenyl)-L-glutamine |
| Synonyms | Source |
|---|---|
| TNP-Glu | ChEBI |
| TNT-Glu | ChEBI |
| Citations |
|---|