EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H2N3O6 |
| Net Charge | 0 |
| Average Mass | 212.097 |
| Monoisotopic Mass | 211.99436 |
| SMILES | *c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| Roles Classification |
|---|
| Biological Roles: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4,6-trinitrophenyl group (CHEBI:53067) has role allergen (CHEBI:50904) |
| 2,4,6-trinitrophenyl group (CHEBI:53067) has role epitope (CHEBI:53000) |
| 2,4,6-trinitrophenyl group (CHEBI:53067) is a organyl group (CHEBI:33249) |
| Incoming Relation(s) |
| Tnp-Gln (CHEBI:72495) has part 2,4,6-trinitrophenyl group (CHEBI:53067) |
| Synonyms | Source |
|---|---|
| 2,4,6-trinitrophenyl | ChEBI |
| TNP | ChEBI |
| trinitrophenyl | ChEBI |
| Citations |
|---|