EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H2N3O6 |
| Net Charge | 0 |
| Average Mass | 212.097 |
| Monoisotopic Mass | 211.99436 |
| SMILES | *c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| Roles Classification |
|---|
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4,6-trinitrophenyl group (CHEBI:53067) has role allergen (CHEBI:50904) |
| 2,4,6-trinitrophenyl group (CHEBI:53067) has role epitope (CHEBI:53000) |
| 2,4,6-trinitrophenyl group (CHEBI:53067) is a organyl group (CHEBI:33249) |
| Incoming Relation(s) |
| Tnp-Gln (CHEBI:72495) has part 2,4,6-trinitrophenyl group (CHEBI:53067) |
| Synonyms | Source |
|---|---|
| 2,4,6-trinitrophenyl | ChEBI |
| TNP | ChEBI |
| trinitrophenyl | ChEBI |
| Citations |
|---|