EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12BrN2O |
| Net Charge | +1 |
| Average Mass | 292.156 |
| Monoisotopic Mass | 291.01275 |
| SMILES | COc1cc2nc3c(C)[nH+]ccc3c2cc1Br |
| InChI | InChI=1S/C13H11BrN2O/c1-7-13-8(3-4-15-7)9-5-10(14)12(17-2)6-11(9)16-13/h3-6,16H,1-2H3/p+1 |
| InChIKey | YRYJSDPQWKIQRL-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-bromoharminium(1+) (CHEBI:72480) is a organic cation (CHEBI:25697) |
| 6-bromoharminium(1+) (CHEBI:72480) is conjugate acid of 6-bromoharmine (CHEBI:72481) |
| Incoming Relation(s) |
| 6-bromoharmine hydrobromide (CHEBI:66004) has part 6-bromoharminium(1+) (CHEBI:72480) |
| 6-bromoharmine (CHEBI:72481) is conjugate base of 6-bromoharminium(1+) (CHEBI:72480) |
| IUPAC Name |
|---|
| 6-bromo-7-methoxy-1-methyl-9H-β-carbolin-2-ium |