EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H50O12S3 |
| Net Charge | 0 |
| Average Mass | 674.897 |
| Monoisotopic Mass | 674.24644 |
| SMILES | [H][C@@]12C[C@H](OS(=O)(=O)O)[C@@]3([H])C[C@H](OS(=O)(=O)O)[C@@H](OS(=O)(=O)O)C[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CC[C@H](C)C(C)C |
| InChI | InChI=1S/C28H50O12S3/c1-16(2)17(3)7-8-18(4)20-9-10-21-19-13-24(38-41(29,30)31)23-14-25(39-42(32,33)34)26(40-43(35,36)37)15-28(23,6)22(19)11-12-27(20,21)5/h16-26H,7-15H2,1-6H3,(H,29,30,31)(H,32,33,34)(H,35,36,37)/t17-,18+,19-,20+,21-,22-,23+,24-,25-,26-,27+,28+/m0/s1 |
| InChIKey | WBHAMVHLRVKJRH-VZAWWNCJSA-N |
| Roles Classification |
|---|
| Biological Roles: | anti-HIV-2 agent An anti-HIV agent that destroys or inhibits the replication of HIV-2, the less infective and less virulent of the two types of HIV virus. anti-HIV-1 agent An anti-HIV agent that destroys or inhibits the replication of HIV-1, the more infective and more virulent of the two types of HIV virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| halistanol sulfonic acid G (CHEBI:72479) has parent hydride 5α-ergostane (CHEBI:20652) |
| halistanol sulfonic acid G (CHEBI:72479) has role anti-HIV-1 agent (CHEBI:64947) |
| halistanol sulfonic acid G (CHEBI:72479) has role anti-HIV-2 agent (CHEBI:64949) |
| halistanol sulfonic acid G (CHEBI:72479) has role metabolite (CHEBI:25212) |
| halistanol sulfonic acid G (CHEBI:72479) is a steroid sulfate (CHEBI:16158) |
| halistanol sulfonic acid G (CHEBI:72479) is conjugate acid of halistanol sulfate G(3−) (CHEBI:72478) |
| Incoming Relation(s) |
| halistanol sulfate G(3−) (CHEBI:72478) is conjugate base of halistanol sulfonic acid G (CHEBI:72479) |
| IUPAC Name |
|---|
| (2β,3α,5α,6α)-ergostane-2,3,6-triyl tris(hydrogen sulfate) |