EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H47O12S3 |
| Net Charge | -3 |
| Average Mass | 671.873 |
| Monoisotopic Mass | 671.22461 |
| SMILES | [H][C@@]12C[C@H](OS(=O)(=O)[O-])[C@@]3([H])C[C@H](OS(=O)(=O)[O-])[C@@H](OS(=O)(=O)[O-])C[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CC[C@H](C)C(C)C |
| InChI | InChI=1S/C28H50O12S3/c1-16(2)17(3)7-8-18(4)20-9-10-21-19-13-24(38-41(29,30)31)23-14-25(39-42(32,33)34)26(40-43(35,36)37)15-28(23,6)22(19)11-12-27(20,21)5/h16-26H,7-15H2,1-6H3,(H,29,30,31)(H,32,33,34)(H,35,36,37)/p-3/t17-,18+,19-,20+,21-,22-,23+,24-,25-,26-,27+,28+/m0/s1 |
| InChIKey | WBHAMVHLRVKJRH-VZAWWNCJSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| halistanol sulfate G(3−) (CHEBI:72478) is a steroid sulfate oxoanion (CHEBI:59696) |
| halistanol sulfate G(3−) (CHEBI:72478) is conjugate base of halistanol sulfonic acid G (CHEBI:72479) |
| Incoming Relation(s) |
| halistanol sulfate G (CHEBI:65997) has part halistanol sulfate G(3−) (CHEBI:72478) |
| halistanol sulfonic acid G (CHEBI:72479) is conjugate acid of halistanol sulfate G(3−) (CHEBI:72478) |
| IUPAC Name |
|---|
| (2β,3α,5α,6α)-ergostane-2,3,6-triyl trisulfate |