EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:72449 - malachite green
| Formula | C23H25N2.Cl |
| Net Charge | 0 |
| Average Mass | 364.920 |
| Monoisotopic Mass | 364.17063 |
| SMILES | CN(C)c1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2ccccc2)cc1.[Cl-] |
| InChI | InChI=1S/C23H25N2.ClH/c1-24(2)21-14-10-19(11-15-21)23(18-8-6-5-7-9-18)20-12-16-22(17-13-20)25(3)4;/h5-17H,1-4H3;1H/q+1;/p-1 |
| InChIKey | FDZZZRQASAIRJF-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| malachite green (CHEBI:72449) has part malachite green cation (CHEBI:44107) |
| malachite green (CHEBI:72449) has role antibacterial agent (CHEBI:33282) |
| malachite green (CHEBI:72449) has role antifungal drug (CHEBI:86327) |
| malachite green (CHEBI:72449) has role carcinogenic agent (CHEBI:50903) |
| malachite green (CHEBI:72449) has role environmental contaminant (CHEBI:78298) |
| malachite green (CHEBI:72449) has role fluorochrome (CHEBI:51217) |
| malachite green (CHEBI:72449) has role histological dye (CHEBI:77178) |
| malachite green (CHEBI:72449) has role teratogenic agent (CHEBI:50905) |
| malachite green (CHEBI:72449) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 4-{[4-(dimethylamino)phenyl](phenyl)methylene}-N,N-dimethylcyclohexa-2,5-dien-1-iminium chloride |
| Synonyms | Source |
|---|---|
| (4-(4-Dimethylaminobenzhydriylidene)cyclohexa-2,5-dienylidene)dimethylammonium chloride | ChemIDplus |
| (4-(alpha-(4-Dimethylamino)phenyl)benzylidene)cyclohexa-2,5-dien-1-ylidene dimethylammonium chloride | ChemIDplus |
| Basic Green 4 | ChemIDplus |
| C.I. 42000 | ChemIDplus |
| CI 42000 | ChemIDplus |
| C.I. Basic Green 4 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C18367 | KEGG COMPOUND |
| Malachite_green | Wikipedia |
| WO2008063374 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3580148 | Reaxys |
| CAS:569-64-2 | ChemIDplus |
| CAS:569-64-2 | KEGG COMPOUND |
| Citations |
|---|