EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:72449 - malachite green
| Formula | C23H25N2.Cl |
| Net Charge | 0 |
| Average Mass | 364.920 |
| Monoisotopic Mass | 364.17063 |
| SMILES | CN(C)c1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2ccccc2)cc1.[Cl-] |
| InChI | InChI=1S/C23H25N2.ClH/c1-24(2)21-14-10-19(11-15-21)23(18-8-6-5-7-9-18)20-12-16-22(17-13-20)25(3)4;/h5-17H,1-4H3;1H/q+1;/p-1 |
| InChIKey | FDZZZRQASAIRJF-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| malachite green (CHEBI:72449) has part malachite green cation (CHEBI:44107) |
| malachite green (CHEBI:72449) has role antibacterial agent (CHEBI:33282) |
| malachite green (CHEBI:72449) has role antifungal drug (CHEBI:86327) |
| malachite green (CHEBI:72449) has role carcinogenic agent (CHEBI:50903) |
| malachite green (CHEBI:72449) has role environmental contaminant (CHEBI:78298) |
| malachite green (CHEBI:72449) has role fluorochrome (CHEBI:51217) |
| malachite green (CHEBI:72449) has role histological dye (CHEBI:77178) |
| malachite green (CHEBI:72449) has role teratogenic agent (CHEBI:50905) |
| malachite green (CHEBI:72449) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 4-{[4-(dimethylamino)phenyl](phenyl)methylene}-N,N-dimethylcyclohexa-2,5-dien-1-iminium chloride |
| Synonyms | Source |
|---|---|
| malachite green chloride salt | ChEBI |
| malachite green chloride | ChEBI |
| (4-(alpha-(4-Dimethylamino)phenyl)benzylidene)cyclohexa-2,5-dien-1-ylidene dimethylammonium chloride | ChemIDplus |
| (4-(4-Dimethylaminobenzhydriylidene)cyclohexa-2,5-dienylidene)dimethylammonium chloride | ChemIDplus |
| Basic Green 4 | ChemIDplus |
| CI Basic Green 4 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C18367 | KEGG COMPOUND |
| WO2008063374 | Patent |
| Malachite_green | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3580148 | Reaxys |
| CAS:569-64-2 | KEGG COMPOUND |
| CAS:569-64-2 | ChemIDplus |
| Citations |
|---|