EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:44107 - malachite green cation
| Formula | C23H25N2 |
| Net Charge | +1 |
| Average Mass | 329.467 |
| Monoisotopic Mass | 329.20123 |
| SMILES | CN(C)c1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25N2/c1-24(2)21-14-10-19(11-15-21)23(18-8-6-5-7-9-18)20-12-16-22(17-13-20)25(3)4/h5-17H,1-4H3/q+1 |
| InChIKey | VFCNQNZNPKRXIT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. antibacterial drug A drug used to treat or prevent bacterial infections. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| malachite green cation (CHEBI:44107) has role antibacterial drug (CHEBI:36047) |
| malachite green cation (CHEBI:44107) has role antifungal drug (CHEBI:86327) |
| malachite green cation (CHEBI:44107) has role fluorochrome (CHEBI:51217) |
| malachite green cation (CHEBI:44107) is a iminium ion (CHEBI:35286) |
| Incoming Relation(s) |
| 4-(21-amino-4,9,12-trioxo-16,19-dioxa-5,8,13-triazahenicos-1-yloxy)-malachite green cation (CHEBI:76213) has functional parent malachite green cation (CHEBI:44107) |
| malachite green (CHEBI:72449) has part malachite green cation (CHEBI:44107) |
| IUPAC Name |
|---|
| 4-{[4-(dimethylamino)phenyl](phenyl)methylene}-N,N-dimethylcyclohexa-2,5-dien-1-iminium |
| Synonyms | Source |
|---|---|
| N-(4-{[4-(dimethylamino)phenyl](phenyl)methylidene}cyclohexa-2,5-dien-1-ylidene)-N-methylmethanaminium | PDBeChem |
| malachite green | ChemIDplus |
| malachite green(1+) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| MGR | PDBeChem |
| DB03895 | DrugBank |
| Malachite_green | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3558618 | Reaxys |
| CAS:10309-95-2 | ChemIDplus |
| Citations |
|---|