EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H37NO8 |
| Net Charge | 0 |
| Average Mass | 539.625 |
| Monoisotopic Mass | 539.25192 |
| SMILES | [H][C@@]12C=C(C)C(=O)[C@@]1(O)CC(CO)=C[C@]1([H])[C@]2(O)[C@H](C)[C@@H](OC(=O)c2ccccc2NC)[C@@]2(OC(C)=O)C(C)(C)[C@@]12[H] |
| InChI | InChI=1S/C30H37NO8/c1-15-11-22-28(36,24(15)34)13-18(14-32)12-20-23-27(4,5)30(23,39-17(3)33)25(16(2)29(20,22)37)38-26(35)19-9-7-8-10-21(19)31-6/h7-12,16,20,22-23,25,31-32,36-37H,13-14H2,1-6H3/t16-,20+,22-,23-,25-,28-,29-,30-/m1/s1 |
| InChIKey | UPAIGGMQTARRMN-CSSCWBSHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | fluorescent probe A role played by a fluorescent molecular entity used to study the microscopic environment by fluorescence spectroscopy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sapintoxin D (CHEBI:72442) has role fluorescent probe (CHEBI:39442) |
| sapintoxin D (CHEBI:72442) has role metabolite (CHEBI:25212) |
| sapintoxin D (CHEBI:72442) is a phorbol ester (CHEBI:37532) |
| sapintoxin D (CHEBI:72442) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| (1aR,1bS,4aR,7aS,7bS,8R,9R,9aS)-9a-acetoxy-4a,7b-dihydroxy-3-(hydroxymethyl)-1,1,6,8-tetramethyl-5-oxo-1a,1b,4,4a,5,7a,7b,8,9,9a-decahydro-1H-cyclopropa[3,4]benzo[1,2-e]azulen-9-yl 2-(methylamino)benzoate |
| Synonym | Source |
|---|---|
| phorbol 12-(2-methylamino)benzoate 13-acetate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6553923 | Reaxys |
| CAS:80998-07-8 | ChemIDplus |
| Citations |
|---|