EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23N5O6 |
| Net Charge | 0 |
| Average Mass | 405.411 |
| Monoisotopic Mass | 405.16483 |
| SMILES | Cc1cc2nc3c(=O)nc(=O)nc-3n(C[C@H](O)[C@H](O)[C@H](O)CO)c2cc1N(C)C |
| InChI | InChI=1S/C18H23N5O6/c1-8-4-9-11(5-10(8)22(2)3)23(6-12(25)15(27)13(26)7-24)16-14(19-9)17(28)21-18(29)20-16/h4-5,12-13,15,24-27H,6-7H2,1-3H3,(H,21,28,29)/t12-,13+,15-/m0/s1 |
| InChIKey | IGQLDUYTWDABFK-GUTXKFCHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus subtilis (ncbitaxon:1423) | - | PubMed (19246992) | |
| Streptomyces davawensis (ncbitaxon:348043) | - | PubMed (19333008) |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| roseoflavin (CHEBI:72346) has functional parent riboflavin (CHEBI:17015) |
| roseoflavin (CHEBI:72346) has role antimicrobial agent (CHEBI:33281) |
| roseoflavin (CHEBI:72346) has role bacterial metabolite (CHEBI:76969) |
| roseoflavin (CHEBI:72346) is a benzopteridine (CHEBI:38925) |
| roseoflavin (CHEBI:72346) is conjugate acid of roseoflavin(1−) (CHEBI:136521) |
| Incoming Relation(s) |
| roseoflavin(1−) (CHEBI:136521) is conjugate base of roseoflavin (CHEBI:72346) |
| IUPAC Name |
|---|
| 1-deoxy-1-[8-(dimethylamino)-7-methyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl]-D-ribitol |
| Synonyms | Source |
|---|---|
| 8-demethyl-8-(dimethylamino)riboflavin | ChemIDplus |
| Roseoflavine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DE102009056597 | Patent |
| RS3 | PDBeChem |
| WO2010019208 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1232122 | Reaxys |
| CAS:51093-55-1 | ChemIDplus |
| Citations |
|---|