EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22N5O6 |
| Net Charge | -1 |
| Average Mass | 404.403 |
| Monoisotopic Mass | 404.15756 |
| SMILES | Cc1cc2nc3c(=O)[n-]c(=O)nc-3n(C[C@H](O)[C@H](O)[C@H](O)CO)c2cc1N(C)C |
| InChI | InChI=1S/C18H23N5O6/c1-8-4-9-11(5-10(8)22(2)3)23(6-12(25)15(27)13(26)7-24)16-14(19-9)17(28)21-18(29)20-16/h4-5,12-13,15,24-27H,6-7H2,1-3H3,(H,21,28,29)/p-1/t12-,13+,15-/m0/s1 |
| InChIKey | IGQLDUYTWDABFK-GUTXKFCHSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| roseoflavin(1−) (CHEBI:136521) is a organic anion (CHEBI:25696) |
| roseoflavin(1−) (CHEBI:136521) is conjugate base of roseoflavin (CHEBI:72346) |
| Incoming Relation(s) |
| roseoflavin (CHEBI:72346) is conjugate acid of roseoflavin(1−) (CHEBI:136521) |
| IUPAC Name |
|---|
| 1-deoxy-1-[8-(dimethylamino)-7-methyl-2,4-dioxo-2H-benzo[g]pteridin-3-id-10(4H)-yl]-D-ribitol |
| UniProt Name | Source |
|---|---|
| roseoflavin | UniProt |