EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12N2O3 |
| Net Charge | 0 |
| Average Mass | 148.162 |
| Monoisotopic Mass | 148.08479 |
| SMILES | NCCOC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H12N2O3/c6-1-2-10-3-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m0/s1 |
| InChIKey | SLTGLTLBIVDQKE-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-(2-aminoethyl)-L-serine (CHEBI:72341) has role antimetabolite (CHEBI:35221) |
| O-(2-aminoethyl)-L-serine (CHEBI:72341) has role antimicrobial agent (CHEBI:33281) |
| O-(2-aminoethyl)-L-serine (CHEBI:72341) has role antineoplastic agent (CHEBI:35610) |
| O-(2-aminoethyl)-L-serine (CHEBI:72341) has role metabolite (CHEBI:25212) |
| O-(2-aminoethyl)-L-serine (CHEBI:72341) is a L-serine derivative (CHEBI:84135) |
| O-(2-aminoethyl)-L-serine (CHEBI:72341) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| O-(2-aminoethyl)-L-serine (CHEBI:72341) is conjugate base of (2S)-2-ammonio-3-(2-ammonioethoxy)propanoate (CHEBI:156137) |
| Incoming Relation(s) |
| (2S)-2-ammonio-3-(2-ammonioethoxy)propanoate (CHEBI:156137) is conjugate acid of O-(2-aminoethyl)-L-serine (CHEBI:72341) |
| IUPAC Name |
|---|
| O-(2-aminoethyl)-L-serine |
| Synonyms | Source |
|---|---|
| (L)-3-(2-Aminoethoxy)alanine | ChemIDplus |
| L-4-oxalysine | ChemIDplus |
| L-3-(2-aminoethoxy)alanine | ChEBI |
| (S)-2-amino-3-(2-aminoethoxy)propanoic acid | ChEBI |
| (S)-2-amino-3-(2-aminoethoxy)propionic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| OLZ | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4243647 | Reaxys |
| CAS:15219-97-3 | ChemIDplus |
| Citations |
|---|