EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12N2O3 |
| Net Charge | 0 |
| Average Mass | 148.162 |
| Monoisotopic Mass | 148.08479 |
| SMILES | NCCOC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H12N2O3/c6-1-2-10-3-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m0/s1 |
| InChIKey | SLTGLTLBIVDQKE-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-(2-aminoethyl)-L-serine (CHEBI:72341) has role antimetabolite (CHEBI:35221) |
| O-(2-aminoethyl)-L-serine (CHEBI:72341) has role antimicrobial agent (CHEBI:33281) |
| O-(2-aminoethyl)-L-serine (CHEBI:72341) has role antineoplastic agent (CHEBI:35610) |
| O-(2-aminoethyl)-L-serine (CHEBI:72341) has role metabolite (CHEBI:25212) |
| O-(2-aminoethyl)-L-serine (CHEBI:72341) is a L-serine derivative (CHEBI:84135) |
| O-(2-aminoethyl)-L-serine (CHEBI:72341) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| O-(2-aminoethyl)-L-serine (CHEBI:72341) is conjugate base of (2S)-2-ammonio-3-(2-ammonioethoxy)propanoate (CHEBI:156137) |
| Incoming Relation(s) |
| (2S)-2-ammonio-3-(2-ammonioethoxy)propanoate (CHEBI:156137) is conjugate acid of O-(2-aminoethyl)-L-serine (CHEBI:72341) |
| IUPAC Name |
|---|
| O-(2-aminoethyl)-L-serine |
| Synonyms | Source |
|---|---|
| (S)-2-amino-3-(2-aminoethoxy)propanoic acid | ChEBI |
| (S)-2-amino-3-(2-aminoethoxy)propionic acid | ChEBI |
| (L)-3-(2-Aminoethoxy)alanine | ChemIDplus |
| L-3-(2-aminoethoxy)alanine | ChEBI |
| L-4-oxalysine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| OLZ | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4243647 | Reaxys |
| CAS:15219-97-3 | ChemIDplus |
| Citations |
|---|