EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H13N2O3 |
| Net Charge | +1 |
| Average Mass | 149.170 |
| Monoisotopic Mass | 149.09207 |
| SMILES | [NH3+]CCOC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C5H12N2O3/c6-1-2-10-3-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/p+1/t4-/m0/s1 |
| InChIKey | SLTGLTLBIVDQKE-BYPYZUCNSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2-ammonio-3-(2-ammonioethoxy)propanoate (CHEBI:156137) is a L-serine derivative (CHEBI:84135) |
| (2S)-2-ammonio-3-(2-ammonioethoxy)propanoate (CHEBI:156137) is conjugate acid of O-(2-aminoethyl)-L-serine (CHEBI:72341) |
| Incoming Relation(s) |
| O-(2-aminoethyl)-L-serine (CHEBI:72341) is conjugate base of (2S)-2-ammonio-3-(2-ammonioethoxy)propanoate (CHEBI:156137) |
| UniProt Name | Source |
|---|---|
| O-(2-aminoethyl)-L-serine | UniProt |