EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H30O2 |
| Net Charge | 0 |
| Average Mass | 254.414 |
| Monoisotopic Mass | 254.22458 |
| SMILES | [H]C(CCCCCC)=C([H])CCCCCCCC(=O)O |
| InChI | InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h7-8H,2-6,9-15H2,1H3,(H,17,18) |
| InChIKey | SECPZKHBENQXJG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexadec-9-enoic acid (CHEBI:72004) is a hexadecenoic acid (CHEBI:24548) |
| hexadec-9-enoic acid (CHEBI:72004) is conjugate acid of hexadec-9-enoate (CHEBI:71449) |
| Incoming Relation(s) |
| palmitoleic acid (CHEBI:28716) is a hexadec-9-enoic acid (CHEBI:72004) |
| hexadec-9-enoate (CHEBI:71449) is conjugate base of hexadec-9-enoic acid (CHEBI:72004) |
| IUPAC Name |
|---|
| hexadec-9-enoic acid |
| Synonyms | Source |
|---|---|
| 16:1 ω-7 | ChEBI |
| 9-hexadecenoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1781015 | Reaxys |