EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H29O2 |
| Net Charge | -1 |
| Average Mass | 253.406 |
| Monoisotopic Mass | 253.21730 |
| SMILES | [H]C(CCCCCC)=C([H])CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h7-8H,2-6,9-15H2,1H3,(H,17,18)/p-1 |
| InChIKey | SECPZKHBENQXJG-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexadec-9-enoate (CHEBI:71449) is a hexadecenoate (CHEBI:78095) |
| hexadec-9-enoate (CHEBI:71449) is a long-chain fatty acid anion (CHEBI:57560) |
| hexadec-9-enoate (CHEBI:71449) is a unsaturated fatty acid anion (CHEBI:2580) |
| hexadec-9-enoate (CHEBI:71449) is conjugate base of hexadec-9-enoic acid (CHEBI:72004) |
| Incoming Relation(s) |
| palmitoleate (CHEBI:32372) is a hexadec-9-enoate (CHEBI:71449) |
| hexadec-9-enoic acid (CHEBI:72004) is conjugate acid of hexadec-9-enoate (CHEBI:71449) |
| IUPAC Name |
|---|
| hexadec-9-enoate |
| Synonyms | Source |
|---|---|
| 9-hexadecenoate | ChEBI |
| 9-hexadecenoate(1−) | ChEBI |
| hexadec-9-enoate(1−) | ChEBI |