EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C31H45N3O8 |
| Net Charge | +1 |
| Average Mass | 588.722 |
| Monoisotopic Mass | 588.32794 |
| SMILES | C=CCNc1c(O)cc2c(O)c1C[C@@H](C)C[C@H](OC)[C@H](O)[C@@H](C)/C=C(\C)[C@H](OC(N)=O)[C@@H](OC)/C=C\C=C(/C)C(=O)N2.[H+] |
| InChI | InChI=1S/C31H45N3O8/c1-8-12-33-26-21-13-17(2)14-25(41-7)27(36)19(4)15-20(5)29(42-31(32)39)24(40-6)11-9-10-18(3)30(38)34-22(28(21)37)16-23(26)35/h8-11,15-17,19,24-25,27,29,33,35-37H,1,12-14H2,2-7H3,(H2,32,39)(H,34,38)/p+1/b11-9-,18-10+,20-15+/t17-,19+,24+,25+,27-,29+/m1/s1 |
| InChIKey | OAKGNIRUXAZDQF-TXHRRWQRSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| retaspimycin(1+) (CHEBI:71974) is a organic cation (CHEBI:25697) |
| retaspimycin(1+) (CHEBI:71974) is conjugate acid of retaspimycin (CHEBI:71975) |
| Incoming Relation(s) |
| retaspimycin hydrochloride (CHEBI:71956) has part retaspimycin(1+) (CHEBI:71974) |
| retaspimycin (CHEBI:71975) is conjugate base of retaspimycin(1+) (CHEBI:71974) |
| Synonym | Source |
|---|---|
| retaspimycin cation | ChEBI |