EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H45N3O8.HCl |
| Net Charge | 0 |
| Average Mass | 624.175 |
| Monoisotopic Mass | 623.29734 |
| SMILES | C=CCNc1c(O)cc2c(O)c1C[C@@H](C)C[C@H](OC)[C@H](O)[C@@H](C)/C=C(\C)[C@H](OC(N)=O)[C@@H](OC)/C=C\C=C(/C)C(=O)N2.Cl |
| InChI | InChI=1S/C31H45N3O8.ClH/c1-8-12-33-26-21-13-17(2)14-25(41-7)27(36)19(4)15-20(5)29(42-31(32)39)24(40-6)11-9-10-18(3)30(38)34-22(28(21)37)16-23(26)35;/h8-11,15-17,19,24-25,27,29,33,35-37H,1,12-14H2,2-7H3,(H2,32,39)(H,34,38);1H/b11-9-,18-10+,20-15+;/t17-,19+,24+,25+,27-,29+;/m1./s1 |
| InChIKey | OIRUWDYJGMHDHJ-AFXVCOSJSA-N |
| Roles Classification |
|---|
| Biological Role: | Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| retaspimycin hydrochloride (CHEBI:71956) has part retaspimycin(1+) (CHEBI:71974) |
| retaspimycin hydrochloride (CHEBI:71956) has role antineoplastic agent (CHEBI:35610) |
| retaspimycin hydrochloride (CHEBI:71956) has role Hsp90 inhibitor (CHEBI:63962) |
| retaspimycin hydrochloride (CHEBI:71956) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| (4E,6Z,8S,9S,10E,12S,13R,14S,16R)-19-(allylamino)-13,20,22-trihydroxy-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(22),4,6,10,18,20-hexaen-9-yl carbamate hydrochloride |
| Synonyms | Source |
|---|---|
| IPI-504 | SUBMITTER |
| retaspimycin monohydrochloride | ChEBI |
| 17-Allylamino-17-demethoxygeldanamycin hydroquinone hydrochloride | ChemIDplus |
| IPI 504 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D09376 | KEGG DRUG |
| WO2010135426 | Patent |
| US2008255080 | Patent |
| WO2005063714 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11329862 | Reaxys |
| CAS:857402-63-2 | ChemIDplus |
| Citations |
|---|