EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42O4 |
| Net Charge | 0 |
| Average Mass | 430.629 |
| Monoisotopic Mass | 430.30831 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])C[C@]2([H])O[C@]3(CC[C@@H](C)CO3)[C@@H](C)[C@]12O |
| InChI | InChI=1S/C27H42O4/c1-16-7-12-26(30-15-16)17(2)27(29)23(31-26)14-22-20-6-5-18-13-19(28)8-10-24(18,3)21(20)9-11-25(22,27)4/h5,16-17,19-23,28-29H,6-15H2,1-4H3/t16-,17-,19+,20-,21+,22+,23+,24+,25+,26-,27-/m1/s1 |
| InChIKey | SYYHBUHOUUETMI-WJOMMTHPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pennogenin (CHEBI:71824) has parent hydride spirostan (CHEBI:26745) |
| pennogenin (CHEBI:71824) has role metabolite (CHEBI:25212) |
| pennogenin (CHEBI:71824) is a 17α-hydroxy steroid (CHEBI:35342) |
| pennogenin (CHEBI:71824) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| pennogenin (CHEBI:71824) is a organic heterohexacyclic compound (CHEBI:51914) |
| pennogenin (CHEBI:71824) is a oxaspiro compound (CHEBI:37948) |
| pennogenin (CHEBI:71824) is a sapogenin (CHEBI:26606) |
| Incoming Relation(s) |
| floribundasaponin A (CHEBI:65901) has functional parent pennogenin (CHEBI:71824) |
| mannioside A (CHEBI:66665) has functional parent pennogenin (CHEBI:71824) |
| IUPAC Name |
|---|
| (3β,25R)-spirost-5-en-3,17-diol |
| Synonym | Source |
|---|---|
| (25R)-spirost-5-ene-3β,17-diol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:53988 | Reaxys |