EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H52O9 |
| Net Charge | 0 |
| Average Mass | 592.770 |
| Monoisotopic Mass | 592.36113 |
| SMILES | [H][C@@]1(O[C@H]2CC[C@@]3(C)C(=CC[C@@]4([H])[C@]5([H])C[C@]6([H])O[C@]7(CC[C@@H](C)CO7)[C@@H](C)[C@]6(O)[C@@]5(C)CC[C@@]43[H])C2)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C33H52O9/c1-17-7-12-32(39-16-17)18(2)33(38)25(42-32)14-23-21-6-5-19-13-20(8-10-30(19,3)22(21)9-11-31(23,33)4)40-29-28(37)27(36)26(35)24(15-34)41-29/h5,17-18,20-29,34-38H,6-16H2,1-4H3/t17-,18-,20+,21-,22+,23+,24-,25+,26-,27+,28-,29-,30+,31+,32-,33-/m1/s1 |
| InChIKey | CGQPDIYJWNSEQF-BJNUSKFXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dracaena mannii (IPNI:534281-1) | stem (BTO:0001300) | PubMed (18481024) | Previous component: stem bark; |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| floribundasaponin A (CHEBI:65901) has functional parent pennogenin (CHEBI:71824) |
| floribundasaponin A (CHEBI:65901) has role anti-inflammatory agent (CHEBI:67079) |
| floribundasaponin A (CHEBI:65901) has role metabolite (CHEBI:25212) |
| floribundasaponin A (CHEBI:65901) is a 17α-hydroxy steroid (CHEBI:35342) |
| floribundasaponin A (CHEBI:65901) is a monosaccharide derivative (CHEBI:63367) |
| floribundasaponin A (CHEBI:65901) is a spirostanyl glycoside (CHEBI:38091) |
| floribundasaponin A (CHEBI:65901) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (3β,25R)-17-hydroxyspirost-5-en-3-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| pennogenin-3-O-β-D-glucopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5387054 | Reaxys |
| Citations |
|---|